|
|
| | 1,2-DICHLORO-4-FLUORO-5-NITROBENZENE Basic information |
| | 1,2-DICHLORO-4-FLUORO-5-NITROBENZENE Chemical Properties |
| Melting point | 17 °C (lit.) | | Boiling point | 247 °C (lit.) | | density | 1.596 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.575(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | form | Low Melting Solid | | color | Pale yellow | | InChI | 1S/C6H2Cl2FNO2/c7-3-1-5(9)6(10(11)12)2-4(3)8/h1-2H | | InChIKey | FXOCDIKCKFOUDE-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1cc(Cl)c(Cl)cc1F | | CAS DataBase Reference | 2339-78-8(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2904990090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1,2-DICHLORO-4-FLUORO-5-NITROBENZENE Usage And Synthesis |
| Chemical Properties | Off-White powder | | Uses | 1,2-Dichloro-4-fluoro-5-nitrobenzene may be used in the combinatorial solid-phase synthesis of bis-heterocyclic compounds. It was employed as solute to investigate the possibility of selective excitation in coupled multispin systems. | | General Description | Proton-detected local field (PDLF) spectra of 1,2-dichloro-4-fluoro-5-nitrobenzene in nematic solvents has been studied. | | Synthesis | Acetylation and chlorination in one pot: add 22.2 g of freshly evaporated p-fluoroaniline and 60 mL of glacial acetic acid into the reaction vessel, raise the temperature to 30 ??, and add 20.4 g of acetic anhydride drop by drop under stirring. After the acetic anhydride was added, the reaction was heated to 60-70 ?? and kept warm until the end. Slightly reduce the temperature to 40 ??, slowly introduce Cl2, maintain the reaction temperature at 40 ~ 50 ??, hold the reaction for 12 h, the end of the reaction. The product was poured into 500 mL of ice water, the solid was precipitated, filtered, and the mother liquor was neutralized with Na2CO3 and then filtered to obtain the crude product. Then recrystallized from 60% aqueous ethanol, obtained white needle solid 2-chloro-4-fluoroacetanilide 29.8 g, yield 79.1%. |
| | 1,2-DICHLORO-4-FLUORO-5-NITROBENZENE Preparation Products And Raw materials |
|