- ZIRCONIUM N-BUTOXIDE
-
- $10.00
-
2026-05-28
- CAS:1071-76-7
- Min. Order: 1KG
- Purity: 99.%
- Supply Ability: 10 ton
- ZIRCONIUM N-BUTOXIDE
-
- $10.00
-
2026-03-20
- CAS:1071-76-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
|
| | ZIRCONIUM N-BUTOXIDE Basic information |
| Product Name: | ZIRCONIUM N-BUTOXIDE | | Synonyms: | 1-butanol,zirconium(4++)salt;N-BUTYL ZIRCONATE;TETRABUTYL ZIRCONATE;zirconiumn-butoxide80%inn-butanol;ZIRCONIUM(IV)N-BUTOXIDE;ZIRCONIUM N-BUTOXIDE;Zirconium n-butoxide solution, 80 wt. % in 1-butanol;1-Butanol,zirconium(4+)salt | | CAS: | 1071-76-7 | | MF: | C16H36O4Zr | | MW: | 383.68 | | EINECS: | 213-995-3 | | Product Categories: | metal alkoxide;Organic-metal salt | | Mol File: | 1071-76-7.mol |  |
| | ZIRCONIUM N-BUTOXIDE Chemical Properties |
| Boiling point | 117°C | | density | 1.05 g/mL at 20 °C | | vapor pressure | 5.6hPa at 20℃ | | refractive index | n20/D 1.465 | | Fp | 38°C | | form | liquid | | Specific Gravity | 1.063 | | color | orange | | Water Solubility | Hydrolyzes in water. | | Sensitive | Moisture Sensitive | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | BRN | 4132649 | | Exposure limits | ACGIH: TWA 5 mg/m3; STEL 10 mg/m3
NIOSH: IDLH 25 mg/m3; TWA 5 mg/m3; STEL 10 mg/m3 | | InChI | 1S/4C4H9O.Zr/c4*1-2-3-4-5;/h4*2-4H2,1H3;/q4*-1;+4 | | InChIKey | BSDOQSMQCZQLDV-UHFFFAOYSA-N | | SMILES | CCCCO[Zr](OCCCC)(OCCCC)OCCCC | | LogP | 0.88 at 20℃ | | CAS DataBase Reference | 1071-76-7(CAS DataBase Reference) | | EPA Substance Registry System | 1-Butanol, zirconium(4+) salt (1071-76-7) |
| Hazard Codes | Xn,Xi | | Risk Statements | 10-20-41-67-37/38-22-36/37 | | Safety Statements | 16-26-39 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 1 | | F | 10-21 | | TSCA | TSCA listed | | HS Code | 3822.19.0080 | | HazardClass | 3 | | PackingGroup | III | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Dam. 1
Flam. Liq. 3
Skin Irrit. 2
STOT SE 3 |
| | ZIRCONIUM N-BUTOXIDE Usage And Synthesis |
| Chemical Properties | white silid | | Uses | Condensation catalyst and cross-linking agent. | | Uses | Zirconium(IV) butoxide solution used in the preparation of CeO2-stabilized zirconia polycrystals gel that have good applications as protective coatings of steel and ferrous alloys. | | Uses | Used in an unconventional method to prepare a gel of CeO2-stabilized zirconia polycrystals that have promising applications as protective coatings of steel and ferrous alloys. | | Flammability and Explosibility | Flammable | | reaction suitability | core: zirconium
reagent type: catalyst |
| | ZIRCONIUM N-BUTOXIDE Preparation Products And Raw materials |
|