Poly(2-acrylamido-2-methyl-1-propanesulfonic acid) manufacturers
|
| | Poly(2-acrylamido-2-methyl-1-propanesulfonic acid) Basic information |
| | Poly(2-acrylamido-2-methyl-1-propanesulfonic acid) Chemical Properties |
| form | Viscous Liquid | | color | Clear | | PH | 1.0-3.0 | | Cosmetics Ingredients Functions | FILM FORMING | | InChI | 1S/C7H13NO4S/c1-4-6(9)8-7(2,3)5-13(10,11)12/h4H,1,5H2,2-3H3,(H,8,9)(H,10,11,12) | | InChIKey | XHZPRMZZQOIPDS-UHFFFAOYSA-N | | SMILES | CC(C)(CS(O)(=O)=O)NC(=O)C=C | | EPA Substance Registry System | 1-Propanesulfonic acid, 2-methyl-2-[(1-oxo-2-propenyl)amino]-, homopolymer (27119-07-9) |
| Hazard Codes | Xi,C | | Risk Statements | 36/37/38-35-34 | | Safety Statements | 26-45-36/37/39 | | RIDADR | UN 3265 8/PG 3 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 39069090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1A |
| | Poly(2-acrylamido-2-methyl-1-propanesulfonic acid) Usage And Synthesis |
| Chemical Properties | clear viscous liquid | | Uses | Thickening agent for acidic or basic cleaning agents, friction reducing agent, water-based lubricant, mineral scale remover and suspension aid for pigments and fillers. Rheology control agent in water and some organic solvents. | | Definition | ChEBI: A macromolecule composed of repeating 2-methyl-2-propionamidopropane-1-sulfonic acid units. |
| | Poly(2-acrylamido-2-methyl-1-propanesulfonic acid) Preparation Products And Raw materials |
|