|
|
| | GLYCIDYL 4-TOLUENESULFONATE Basic information |
| Product Name: | GLYCIDYL 4-TOLUENESULFONATE | | Synonyms: | TOLUENE-4-SULFONIC ACID OXIRANYLMETHYL ESTER;GLYCIDYL 4-TOLUENESULFONATE;5-Methyl-2-(oxiran-2-ylMethyl)benzene-1-sulfonate;OxiraneMethanol, 4-Methylbenzenesulfonate;2-Oxiranemethanol,2-(4-methylbenzenesulfonate);2,3-Epoxypropyl p-toluenesulfonate | | CAS: | 6746-81-2 | | MF: | C10H12O4S | | MW: | 228.26 | | EINECS: | | | Product Categories: | | | Mol File: | 6746-81-2.mol |  |
| | GLYCIDYL 4-TOLUENESULFONATE Chemical Properties |
| Boiling point | 95-100 °C(Press: 0.01 Torr) | | density | 1.310±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C10H12O4S/c1-8-2-4-10(5-3-8)15(11,12)14-7-9-6-13-9/h2-5,9H,6-7H2,1H3 | | InChIKey | NOQXXYIGRPAZJC-UHFFFAOYSA-N | | SMILES | C1(=CC=C(C)C=C1)S(=O)(=O)OCC1OC1 |
| | GLYCIDYL 4-TOLUENESULFONATE Usage And Synthesis |
| Uses | Glycidyl 4-Toluenesulfonate is used in the development and validation of a chiral HPLC method for rapid screening of allylic alcohol asymmetric epoxidation processes. Glycidyl 4-Toluenesulfonate is a reagent for organic displacement, additional and ring-opening reactions. |
| | GLYCIDYL 4-TOLUENESULFONATE Preparation Products And Raw materials |
|