|
|
| | 8-Quinolinesulfonyl chloride Basic information |
| | 8-Quinolinesulfonyl chloride Chemical Properties |
| Melting point | 126-129 °C(lit.) | | Boiling point | 306°C | | density | 1.483±0.06 g/cm3(Predicted) | | Fp | 306°C | | storage temp. | Inert atmosphere,2-8°C | | solubility | methanol: soluble10mg/mL, clear, colorless to light yellow | | pka | 0+-.0.17(Predicted) | | form | powder to crystal | | color | White to Orange to Green | | Sensitive | Moisture Sensitive | | BRN | 156347 | | InChI | InChI=1S/C9H6ClNO2S/c10-14(12,13)8-5-1-3-7-4-2-6-11-9(7)8/h1-6H | | InChIKey | JUYUYCIJACTHMK-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=CC=2S(Cl)(=O)=O)C=CC=1 | | CAS DataBase Reference | 18704-37-5(CAS DataBase Reference) | | NIST Chemistry Reference | Sulfonyl chloride, 8-quinoline-(18704-37-5) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45-27 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | RTECS | VC2830000 | | F | 3-10-21 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29334990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 8-Quinolinesulfonyl chloride Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 8-Quinolinesulfonyl chloride was used as a coupling reagent in oligonucleotide synthesis. It was also used in the synthesis of olefins from secondary esters at moderate temperature | | General Description | 8-Quinolinesulfonyl chloride reacts with aromatic/heterocyclic sulfonamides containing a free amino, imino, hydrazino or hydroxyl group to form water-soluble compounds. | | Synthesis | The general procedure for the synthesis of quinoline-8-sulfonyl chloride from quinoline-8-sulfonic acid is as follows: chlorosulfonic acid (6.0 g, 51.5 mmol) was added to a reaction vessel fitted with a magnetic stirrer under nitrogen protection. Quinoline (1.0 g, 7.74 mmol) was slowly added under cooling in an ice bath. Subsequently, the reaction system was gradually warmed to 140 °C and the reaction was continuously stirred at this temperature for 10 hours. Upon completion of the reaction, the system was cooled to 40 °C and thionyl chloride (2.0 g, 16.0 mmol) was added dropwise. Then, the reaction temperature was raised to 70 °C and the reaction continued to be stirred for 4 hours. At the end of the reaction, the reaction system was allowed to cool naturally to room temperature, and the reaction solution was slowly poured into ice water, which immediately precipitated a solid. After stirring the mixture for 30 min, the solid product was collected by filtration and dried under vacuum to give quinoline-8-sulfonyl chloride (1.7 g, 99% yield). Mass spectrometry analysis showed m/z: 228.0 (M+1). | | References | [1] Patent: WO2018/156297, 2018, A1. Location in patent: Paragraph 0101; 0114; 0115; 0116; 0117
[2] Synthesis, 2004, # 18, p. 2999 - 3004
[3] Chemische Berichte, 1908, vol. 41, p. 942
[4] Chemische Berichte, 1886, vol. 19, p. 925 |
| | 8-Quinolinesulfonyl chloride Preparation Products And Raw materials |
|