|
|
| | 4'-Aminoazobenzene-4-sulphonic acid Basic information |
| Product Name: | 4'-Aminoazobenzene-4-sulphonic acid | | Synonyms: | 4-((4-aminophenyl)azo)-benzenesulfonicaci;(4-ANILINOAZO)BENZENE-4-SULFONIC ACID SODIUM SALT;4-[(4'-SULFOPHENYL)AZO]ANILINE SODIUM SALT;Para amino azo benzene 4 sulphonic acid;4-(4-Amino-phenylazo)-benzenesulfonic acid anion SODIUM SALT;4-((4-aminophenyl)diazenyl)benzenesulfonic acid;PARA AMINOAZOBENZENE-4-SULFONIC ACID (PAAB4SA);P-AMINOAZOBENZENE-4'-SULFONIC ACID | | CAS: | 104-23-4 | | MF: | C12H11N3O3S | | MW: | 277.3 | | EINECS: | 203-187-9 | | Product Categories: | Intermediates of Dyes and Pigments;Organics | | Mol File: | 104-23-4.mol |  |
| | 4'-Aminoazobenzene-4-sulphonic acid Chemical Properties |
| Boiling point | 477.42℃[at 101 325 Pa] | | density | 1.3764 (rough estimate) | | vapor pressure | 0-0Pa at 25℃ | | refractive index | 1.6630 (estimate) | | solubility | 345.945mg/L in organic solvents at 20 ℃ | | pka | -1.10±0.50(Predicted) | | Water Solubility | 513-1320mg/L at 37℃ | | InChI | InChI=1S/C12H11N3O3S/c13-9-1-3-10(4-2-9)14-15-11-5-7-12(8-6-11)19(16,17)18/h1-8H,13H2,(H,16,17,18) | | InChIKey | PPVRMPPLECDING-UHFFFAOYSA-N | | SMILES | C1(S(O)(=O)=O)=CC=C(N=NC2=CC=C(N)C=C2)C=C1 | | LogP | -0.352 at 37℃ | | CAS DataBase Reference | 104-23-4(CAS DataBase Reference) | | EPA Substance Registry System | C.I. Food Yellow 6 (104-23-4) |
| Provider | Language |
|
ALFA
| English |
| | 4'-Aminoazobenzene-4-sulphonic acid Usage And Synthesis |
| Uses | 4''-Aminoazobenzene-4-sulphonic Acid can be used in photocatalytic wastewater treatment | | Preparation | 4-(Phenyldiazenyl)benzenaminesulfonated. | | General Description | 4'-Aminoazobenzene-4-sulphonic acid, also known as 4-((4-aminophenyl)diazenyl)benzenesulfonic acid, is an important organic intermediate compound that can be used for the coupling of (arylamino)methanesulfonic acid and the preparation of dyes. | | Flammability and Explosibility | Non flammable |
| | 4'-Aminoazobenzene-4-sulphonic acid Preparation Products And Raw materials |
|