| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4-Hydroxy-4-(2-methoxy-5-nitrophenyl)-2-butanone Basic information |
| | 4-Hydroxy-4-(2-methoxy-5-nitrophenyl)-2-butanone Chemical Properties |
| Melting point | 97-100 °C (lit.) | | InChI | 1S/C11H13NO5/c1-7(13)5-10(14)9-6-8(12(15)16)3-4-11(9)17-2/h3-4,6,10,14H,5H2,1-2H3 | | InChIKey | MKTFIKYMHQLEDD-UHFFFAOYSA-N | | SMILES | COc1ccc(cc1C(O)CC(C)=O)[N+]([O-])=O |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | 4-Hydroxy-4-(2-methoxy-5-nitrophenyl)-2-butanone Usage And Synthesis |
| Uses | 4-Hydroxy-4-(2-methoxy-5- nitrophenyl)-2-butanone is an organic building block. | | General Description | 4-Hydroxy-4-(2-methoxy-5- nitrophenyl)-2-butanone is an organic building block. |
| | 4-Hydroxy-4-(2-methoxy-5-nitrophenyl)-2-butanone Preparation Products And Raw materials |
|