|
|
| | 2,4-dihydroxy-6-n-butylbenzoic acid, methyl ester Basic information |
| Product Name: | 2,4-dihydroxy-6-n-butylbenzoic acid, methyl ester | | Synonyms: | 2,4-dihydroxy-6-n-butylbenzoic acid, methyl ester;Benzoic acid, 2-butyl-4,6-dihydroxy-, methyl ester;2,4-dihydroxy-6-n-butylbenzoic acid;Methyl 2,4-dihydroxy-6-Butylbenzoate,;2,4-Dihydroxy-6-n-butylmethylbenzoate;2,4-Dihydroxy-6-ButylBenzoic acid methyl ester | | CAS: | 102342-62-1 | | MF: | C12H16O4 | | MW: | 224.25 | | EINECS: | 000-000-0 | | Product Categories: | | | Mol File: | 102342-62-1.mol |  |
| | 2,4-dihydroxy-6-n-butylbenzoic acid, methyl ester Chemical Properties |
| Boiling point | 398.6±27.0 °C(Predicted) | | density | 1.180±0.06 g/cm3(Predicted) | | pka | 8.27±0.23(Predicted) | | InChI | InChI=1S/C12H16O4/c1-3-4-5-8-6-9(13)7-10(14)11(8)12(15)16-2/h6-7,13-14H,3-5H2,1-2H3 | | InChIKey | CWJSSPNEXCIPSN-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=C(O)C=C(O)C=C1CCCC |
| | 2,4-dihydroxy-6-n-butylbenzoic acid, methyl ester Usage And Synthesis |
| Uses | 2,4-Dihydroxy-6-n-butylbenzoic acid methyl ester is an organic ester compound containing a dihydroxy functional group, which can be used as an organic synthesis intermediate. |
| | 2,4-dihydroxy-6-n-butylbenzoic acid, methyl ester Preparation Products And Raw materials |
|