|
|
| | Oleuroside Basic information |
| Product Name: | Oleuroside | | Synonyms: | Oleuroside;2H-Pyran-4-acetic acid, 3-ethenyl-2-(β-D-glucopyranosyloxy)-3,4-dihydro-5-(methoxycarbonyl)-, 2-(3,4-dihydroxyphenyl)ethyl ester, (2S,3R,4S)-;(2S,3R,4S)-Methyl 4-(2-(3,4-dihydroxyphenethoxy)-2-oxoethyl)-2-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)-3-vinyl-3,4-dihydro-2H-pyran-5-carboxylate | | CAS: | 116383-31-4 | | MF: | C25H32O13 | | MW: | 540.52 | | EINECS: | | | Product Categories: | | | Mol File: | 116383-31-4.mol |  |
| | Oleuroside Chemical Properties |
| Boiling point | 759.8±60.0 °C(Predicted) | | density | 1.49±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | Soluble in DMSO | | form | Solid | | pka | 9.70±0.10(Predicted) | | color | White to off-white | | InChIKey | WWKVQWHAWPZZDB-ASNPJKIBSA-N | | SMILES | O=C(OC)C1=CO[C@@H](O[C@@]2([H])[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O2)[C@H](C=C)[C@@H]1CC(OCCC3=CC(O)=C(O)C=C3)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Oleuroside Usage And Synthesis |
| Uses | Oleuroside is a phenolic secoiridoid in olive. Oleuroside can protect against mitochondrial dysfunction in models of early Alzheimer's disease and brain ageing[1]. | | Definition | ChEBI: Oleuroside is a terpene glycoside. | | References | [1] Grewal R, et al. Purified oleocanthal and ligstroside protect against mitochondrial dysfunction in models of early Alzheimer's disease and brain ageing. Exp Neurol.2020 Feb 18:113248. DOI:10.1016/j.expneurol.2020.113248 |
| | Oleuroside Preparation Products And Raw materials |
|