|
|
| | 7-CHLORO-THIENO[2,3-C] PYRIDINE Basic information |
| | 7-CHLORO-THIENO[2,3-C] PYRIDINE Chemical Properties |
| Melting point | 39-42° | | Boiling point | 106 °C(Press: 0.5 Torr) | | density | 1.435 | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: 30 mg/ml; Ethanol:PBS (pH 7.2) (1:1): 0.5 mg/ml | | form | A crystalline solid | | pka | -0.35±0.30(Predicted) | | Appearance | brown solid | | InChI | InChI=1S/C7H4ClNS/c8-7-6-5(1-3-9-7)2-4-10-6/h1-4H | | InChIKey | HRHLEPHFARWKKU-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=CC2C=CSC1=2 |
| | 7-CHLORO-THIENO[2,3-C] PYRIDINE Usage And Synthesis |
| Uses | 7-Chlorothieno[2,3-c]Pyridine is a synthetic intermediate and OLED intermediate component for the preparation of organic electroluminescent materials and devices. |
| | 7-CHLORO-THIENO[2,3-C] PYRIDINE Preparation Products And Raw materials |
|