| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
|
| | 2-(6,7-Diethoxy-1,2,3,4-tetrahydro-isoquinolin-1-yl)-ethanol Basic information |
| Product Name: | 2-(6,7-Diethoxy-1,2,3,4-tetrahydro-isoquinolin-1-yl)-ethanol | | Synonyms: | 1-Isoquinolineethanol, 6,7-diethoxy-1,2,3,4-tetrahydro-;2-(6,7-Diethoxy-1,2,3,4-tetrahydro-isoquinolin-1-yl)-ethanol | | CAS: | 955314-83-7 | | MF: | C15H23NO3 | | MW: | 265.35 | | EINECS: | | | Product Categories: | | | Mol File: | 955314-83-7.mol |  |
| | 2-(6,7-Diethoxy-1,2,3,4-tetrahydro-isoquinolin-1-yl)-ethanol Chemical Properties |
| Boiling point | 422.9±45.0 °C(Predicted) | | density | 1.068±0.06 g/cm3(Predicted) | | pka | 14.89±0.10(Predicted) | | form | solid | | InChI | 1S/C15H23NO3/c1-3-18-14-9-11-5-7-16-13(6-8-17)12(11)10-15(14)19-4-2/h9-10,13,16-17H,3-8H2,1-2H3 | | InChIKey | YULIMDKKVQKHCR-UHFFFAOYSA-N | | SMILES | OCCC1NCCC(C=C2OCC)=C1C=C2OCC |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HS Code | 2933499090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-(6,7-Diethoxy-1,2,3,4-tetrahydro-isoquinolin-1-yl)-ethanol Usage And Synthesis |
| | 2-(6,7-Diethoxy-1,2,3,4-tetrahydro-isoquinolin-1-yl)-ethanol Preparation Products And Raw materials |
|