| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
3,5-Bis(trifluoromethyl)-1,2-diaminobenzene manufacturers
|
| | 3,5-Bis(trifluoromethyl)-1,2-diaminobenzene Basic information |
| Product Name: | 3,5-Bis(trifluoromethyl)-1,2-diaminobenzene | | Synonyms: | 3,5-bis(trifluoroMethyl)benzene-1,2-diaMine;3,5-Bis(trifluoroMethyl)benzene-1,2dianiline;1,2-DIAMINO-3,5-BIS(TRIFLUOROMETHYL)BENZENE;3,5-Bis(trifluoromethyl)-1,2-diaminobenzene~1,2-Diamino-3,5-bis(trifluoromethyl)benzene;3,5-Bis(trifluoromethyl)-1,2-diaminobenzene, 97+%;3,5-Bis(trifluoromethyl)phenylene-1,2-diamine;3,5-Bis(trifluoromethyl)-1,2-diam;3,5-Bis(trifluoromethyl)-o-phenylenediamine, 97% | | CAS: | 367-65-7 | | MF: | C8H6F6N2 | | MW: | 244.14 | | EINECS: | 670-794-7 | | Product Categories: | | | Mol File: | 367-65-7.mol |  |
| | 3,5-Bis(trifluoromethyl)-1,2-diaminobenzene Chemical Properties |
| Melting point | 42-44°C | | Boiling point | 228.2±40.0 °C(Predicted) | | density | 1.516±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | solid | | pka | 1.72±0.10(Predicted) | | Appearance | Light brown to brown Solid | | Water Solubility | Insoluble in water. | | BRN | 3344332 | | InChI | 1S/C8H6F6N2/c9-7(10,11)3-1-4(8(12,13)14)6(16)5(15)2-3/h1-2H,15-16H2 | | InChIKey | BRLIJPMFMGTIAW-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1c(c(cc(c1)C(F)(F)F)N)N | | CAS DataBase Reference | 367-65-7(CAS DataBase Reference) |
| Hazard Codes | T | | Risk Statements | 20/21/22-36/37/38-36 | | Safety Statements | 26-36/37/39 | | RIDADR | 2811 | | WGK Germany | WGK 3 | | Hazard Note | Toxic | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2921599090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| Provider | Language |
|
ALFA
| English |
| | 3,5-Bis(trifluoromethyl)-1,2-diaminobenzene Usage And Synthesis |
| Uses | It is applied as an active pharmaceutical intermediate. |
| | 3,5-Bis(trifluoromethyl)-1,2-diaminobenzene Preparation Products And Raw materials |
|