| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
2-Fluoro-5-(trifluoromethyl)benzylamine manufacturers
|
| | 2-Fluoro-5-(trifluoromethyl)benzylamine Basic information |
| Product Name: | 2-Fluoro-5-(trifluoromethyl)benzylamine | | Synonyms: | [2-Fluoro-5-(trifluoromethyl)phenyl]methanamine;RARECHEM AL BW 0667;2-Fluoro-5-(trifluoromethyl)benzylamine 97%;2-Fluoro-5-(trifluoromethyl)benzylamine97%;2-FLORO-5-(TRIFLUOROMETHYL)BENZYLAMINE;2-fluoro-5-(trifluoromethyl)benzyla;1-[2-fluoro-5-(trifluoromethyl)phenyl]methanamine;Benzenemethanamine, 2-fluoro-5-(trifluoromethyl)- | | CAS: | 199296-61-2 | | MF: | C8H7F4N | | MW: | 193.14 | | EINECS: | | | Product Categories: | Fluorine series;Amine | | Mol File: | 199296-61-2.mol |  |
| | 2-Fluoro-5-(trifluoromethyl)benzylamine Chemical Properties |
| Boiling point | 175.9±35.0 °C(Predicted) | | density | 1.312±0.06 g/cm3(Predicted) | | refractive index | 1.451 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 8.27±0.10(Predicted) | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | Sensitive | Air Sensitive | | InChI | InChI=1S/C8H7F4N/c9-7-2-1-6(8(10,11)12)3-5(7)4-13/h1-3H,4,13H2 | | InChIKey | WIQWADYBGSRGCF-UHFFFAOYSA-N | | SMILES | C1(CN)=CC(C(F)(F)F)=CC=C1F | | CAS DataBase Reference | 199296-61-2(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Fluoro-5-(trifluoromethyl)benzylamine(199296-61-2) |
| Hazard Codes | C,Xi,T | | Risk Statements | 34-25 | | Safety Statements | 26-36/37/39-45 | | RIDADR | 2735 | | Hazard Note | Corrosive/Store under nitrogen | | HazardClass | 8 | | PackingGroup | III | | HS Code | 2921490090 |
| Provider | Language |
|
ALFA
| English |
| | 2-Fluoro-5-(trifluoromethyl)benzylamine Usage And Synthesis |
| | 2-Fluoro-5-(trifluoromethyl)benzylamine Preparation Products And Raw materials |
|