| Company Name: |
Hebei Summedchem Co.,Ltd
|
| Tel: |
0319-5801333-8008 15630992918 |
| Email: |
sales@summedchem.com |
| Products Intro: |
Product Name:3-Bromo-2-chloro-6-(difluoromethyl)pyridine CAS:1805221-46-8 Purity:98% Package:1G;25G;100G;500G;1KG;10KG;100KG;1002KG
|
| Company Name: |
Bide Pharmatech Ltd.
|
| Tel: |
400-400-164-7117 18317119277 |
| Email: |
product02@bidepharm.com |
| Products Intro: |
Product Name:3-Bromo-2-chloro-6-(difluoromethyl)pyridine CAS:1805221-46-8 Purity:97% Package:50mg;100mg;250mg Remarks:BD624002
|
| Company Name: |
Nanjing SynTitan Pharmaceutical Co., Ltd.
|
| Tel: |
025-57027686 17372956142 |
| Email: |
li_lan@syntitan.com |
| Products Intro: |
Product Name:3-bromo-2-chloro-6-(difluoromethyl)pyridine CAS:1805221-46-8 Purity:97% Package:1g;5g
|
| Company Name: |
Zhuhai Aobokai Biomedical Technology Co., Ltd.
|
| Tel: |
400-0628126 |
| Email: |
sales@aobchem.com.cn |
| Products Intro: |
Product Name:3-Bromo-2-chloro-6-(difluoromethyl)pyridine CAS:1805221-46-8 Purity:>=95% Package:3993元/100mg;5167元/250mg Remarks:402248
|
|
| | 3-Bromo-2-chloro-6-difluoromethyl-pyridine Basic information |
| | 3-Bromo-2-chloro-6-difluoromethyl-pyridine Chemical Properties |
| storage temp. | Storage temp. 2-8°C | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C6H3BrClF2N/c7-3-1-2-4(6(9)10)11-5(3)8/h1-2,6H | | InChIKey | BLLVLEFBHDUOQV-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC(C(F)F)=CC=C1Br |
| | 3-Bromo-2-chloro-6-difluoromethyl-pyridine Usage And Synthesis |
| | 3-Bromo-2-chloro-6-difluoromethyl-pyridine Preparation Products And Raw materials |
|