| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 3-Bromo-2-chloro-6-picoline Basic information |
| | 3-Bromo-2-chloro-6-picoline Chemical Properties |
| Melting point | 30-35°C | | Boiling point | 234.2±35.0 °C(Predicted) | | density | 1.6567 (rough estimate) | | refractive index | 1.5400 (estimate) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | Solid | | pka | 0.33±0.10(Predicted) | | color | Yellow | | InChI | InChI=1S/C6H5BrClN/c1-4-2-3-5(7)6(8)9-4/h2-3H,1H3 | | InChIKey | JVDQYSIJBRTRMS-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC(C)=CC=C1Br | | CAS DataBase Reference | 185017-72-5(CAS DataBase Reference) |
| Hazard Codes | Xi,T | | Risk Statements | 36/37/38-41-37/38-25 | | Safety Statements | 37/39-26-45-39 | | RIDADR | 2811 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | Ⅲ | | HS Code | 29333990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| Provider | Language |
|
ACROS
| English |
| | 3-Bromo-2-chloro-6-picoline Usage And Synthesis |
| Chemical Properties | Yellow low melting solid or liquid | | Uses | 3-BROMO-2-CHLORO-6-PICOLINE serves as a versatile intermediate in organic synthesis,
particularly in cross-coupling reactions for pharmaceuticals,
agrochemicals, and materials science. Its reactivity is influenced by
the bromine and chlorine substituents, which act as leaving groups, and
the methyl group, which modulates steric and electronic effects. |
| | 3-Bromo-2-chloro-6-picoline Preparation Products And Raw materials |
|