| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
4,5,6,7-tetradeuterio-2-(trichloromethylsulfanyl)isoindole-1,3-dione manufacturers
- Folpet-D4
-
-
2026-05-11
- CAS:1327204-12-5
- Purity:
- Supply Ability: 10g
|
| | 4,5,6,7-tetradeuterio-2-(trichloromethylsulfanyl)isoindole-1,3-dione Basic information |
| | 4,5,6,7-tetradeuterio-2-(trichloromethylsulfanyl)isoindole-1,3-dione Chemical Properties |
| solubility | Chloroform (Slightly), Methanol (Very Slightly) | | form | Solid | | color | White to Off-White | | Major Application | agriculture environmental | | InChI | 1S/C9H4Cl3NO2S/c10-9(11,12)16-13-7(14)5-3-1-2-4-6(5)8(13)15/h1-4H/i1D,2D,3D,4D | | InChIKey | HKIOYBQGHSTUDB-RHQRLBAQSA-N | | SMILES | ClC(Cl)(Cl)SN1C(C2=C([2H])C([2H])=C([2H])C([2H])=C2C1=O)=O |
| WGK Germany | WGK 2 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Inhalation Aquatic Acute 1 Carc. 2 Eye Irrit. 2 Skin Sens. 1 |
| | 4,5,6,7-tetradeuterio-2-(trichloromethylsulfanyl)isoindole-1,3-dione Usage And Synthesis |
| Uses | Labelled Folpet (F402000). Agricultural fungicide. |
| | 4,5,6,7-tetradeuterio-2-(trichloromethylsulfanyl)isoindole-1,3-dione Preparation Products And Raw materials |
|