| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
9-Aminofluorene hydrochloride manufacturers
|
| | 9-Aminofluorene hydrochloride Basic information |
| | 9-Aminofluorene hydrochloride Chemical Properties |
| Melting point | 265-270 °C (dec.)(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | color | White to Light yellow | | Sensitive | Hygroscopic | | BRN | 3915368 | | InChI | InChI=1S/C13H11N.ClH/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13;/h1-8,13H,14H2;1H | | InChIKey | SYKJOJSYQSVNOM-UHFFFAOYSA-N | | SMILES | C1(N)C2=C(C=CC=C2)C2=C1C=CC=C2.[H]Cl | | CAS DataBase Reference | 5978-75-6(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | WGK Germany | 3 | | RTECS | LL5130000 | | PackingGroup | III | | HS Code | 2921490090 | | Storage Class | 13 - Non Combustible Solids |
| | 9-Aminofluorene hydrochloride Usage And Synthesis |
| Chemical Properties | WHITE TO BEIGE CRYSTALLINE POWDER | | Synthesis | In the first step, 9-fluorenone oxime (400 mg) was mixed with a solution of concentrated hydrochloric acid (0.86 mL) in ethanol (50 mL), 10% Pd/C catalyst (33 mg) was added, and the hydrogenation reaction was carried out at atmospheric pressure. Upon completion of the reaction, the reaction mixture was filtered to remove the catalyst and the filtrate was concentrated. The concentrated residue was suspended in ethyl acetate and filtered again to give 9-aminofluorene hydrochloride (240 mg) as a white solid. | | References | [1] Patent: EP2511283, 2012, A1. Location in patent: Page/Page column 92-93 [2] Patent: US2013/45942, 2013, A1. Location in patent: Paragraph 0390 [3] Patent: JP2015/172077, 2015, A. Location in patent: Paragraph 0190 |
| | 9-Aminofluorene hydrochloride Preparation Products And Raw materials |
|