| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Methyl 4,6-dimethoxy-2-indolecarboxylate Basic information |
| Product Name: | Methyl 4,6-dimethoxy-2-indolecarboxylate | | Synonyms: | 4,6-dimethoxy-3-methyl-1H-indole-2-carboxylate;4,6-DIMETHOXY-1H-INDOLE-2-CARBOXYLIC ACID METHYL ESTER;AKOS JY2082859;Methyl-4,6-dimethoxyindole-2-carboxylate;methyl 4,6-dimethoxy-1H-indole-2-carboxylate;1H-Indole-2-carboxylic acid, 4,6-dimethoxy-, methyl ester;Methyl 4,6-dimethoxy-2-indolecarboxylate 99%;Methyl 4,6-dimethoxy-2-indolecarboxylate | | CAS: | 105776-13-4 | | MF: | C12H13NO4 | | MW: | 235.24 | | EINECS: | | | Product Categories: | Building Blocks;Heterocyclic Building Blocks;Indoles;Indoline & Oxindole | | Mol File: | 105776-13-4.mol |  |
| | Methyl 4,6-dimethoxy-2-indolecarboxylate Chemical Properties |
| Melting point | 182-183 °C (lit.) | | storage temp. | Sealed in dry,Room Temperature | | InChI | 1S/C12H13NO4/c1-15-7-4-9-8(11(5-7)16-2)6-10(13-9)12(14)17-3/h4-6,13H,1-3H3 | | InChIKey | TVUJONIYWNBWPM-UHFFFAOYSA-N | | SMILES | COC(=O)c1cc2c(OC)cc(OC)cc2[nH]1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Methyl 4,6-dimethoxy-2-indolecarboxylate Usage And Synthesis |
| Uses | Methyl 4,6-dimethoxy-2-indolecarboxylate may be used as reactant:
- in the nitration reactions with nitric acid
- in the preparation of light-dependent tumor necrosis factor-α inhibitors
| | General Description | Methyl 4,6-dimethoxy-2-indolecarboxylate is an indole derivative. |
| | Methyl 4,6-dimethoxy-2-indolecarboxylate Preparation Products And Raw materials |
|