|
|
| | (S)-1-[3,5-Bis(trifluoromethyl)phenyl]ethanol Basic information |
| Product Name: | (S)-1-[3,5-Bis(trifluoromethyl)phenyl]ethanol | | Synonyms: | (S)-1-[3,6-Bis(trifluoromethyl)phenyl]ethanol;(S)-1-[3,5-Bis(trifluoromethyl)phenyl]ethanol,99%e.e.;(S)-1-[3,5-BIS(TRIFLUOROMETHYL)PHENYL]ETHANOL;(S)-1-[BIS-3,5-(TRIFLUOROMETHYL)PHENYL]ETHANOL;S-MBT-PEL;(S)-1-[3,5-Bis(trifluoromethyl)phenyl]ethan-1-ol;(1R)-1-[3,5-BIS(TRIFLUOROMETHYL)PHENYL]ETHANOL;(1S)-(-)-1-[3,5-Bis(trifluoromethyl)phenyl]ethan-1-ol | | CAS: | 225920-05-8 | | MF: | C10H8F6O | | MW: | 258.16 | | EINECS: | 218-863-9 | | Product Categories: | Alcohols, Hydroxy Esters and Derivatives;Chiral Compounds;API intermediates;Aromatics;Chiral Reagents;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 225920-05-8.mol | ![(S)-1-[3,5-Bis(trifluoromethyl)phenyl]ethanol Structure](CAS/GIF/225920-05-8.gif) |
| | (S)-1-[3,5-Bis(trifluoromethyl)phenyl]ethanol Chemical Properties |
| Melting point | 53.0 to 57.0 °C | | Boiling point | 175.8±35.0 °C(Predicted) | | density | 1.376±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 13.99±0.20(Predicted) | | color | White to Off-White | | λmax | 254nm(lit.) | | InChI | InChI=1/C10H8F6O/c1-5(17)6-2-7(9(11,12)13)4-8(3-6)10(14,15)16/h2-5,17H,1H3/t5-/s3 | | InChIKey | MMSCIQKQJVBPIR-GQMHJJTINA-N | | SMILES | C1(C(F)(F)F)C=C(C=C(C(F)(F)F)C=1)[C@@H](O)C |&1:14,r| | | CAS DataBase Reference | 225920-05-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | Hazard Note | Irritant | | HS Code | 29062990 |
| | (S)-1-[3,5-Bis(trifluoromethyl)phenyl]ethanol Usage And Synthesis |
| Chemical Properties | White solid | | Uses | Aprepitant intermediate. | | Synthesis | General procedure: under argon protection, the ruthenium complex Ru(OTf)[(S,S)-iso-BuSO2dpen] (p-cymene) (1.4 mg, 0.002 mmol), potassium formate (1.0 g, 12 mmol), and 3,5-bis(trifluoromethyl)acetophenone (2.56 g, 10 mmol, substrate to catalyst ratio 5000:1) were added to a 20 mL glass Schlenk reaction tube. Subsequently, methanol (6 mL) was added and the reaction was stirred at 50 °C for 24 hours. Upon completion of the reaction, (S)-1-[3,5-bis(trifluoromethyl)phenyl]ethanol was obtained in 100% yield with an enantiomeric excess (ee) value of 87.7%. | | References | [1] Patent: US2011/282077, 2011, A1. Location in patent: Page/Page column 8
[2] Angewandte Chemie - International Edition, 2011, vol. 50, # 32, p. 7329 - 7332
[3] Tetrahedron Asymmetry, 2006, vol. 17, # 4, p. 554 - 559
[4] Patent: CN108059579, 2018, A. Location in patent: Paragraph 0057-0061
[5] Tetrahedron, 2004, vol. 60, # 3, p. 789 - 797 |
| | (S)-1-[3,5-Bis(trifluoromethyl)phenyl]ethanol Preparation Products And Raw materials |
|