2,2,2-TRIFLUOROETHANOL-D3 manufacturers
|
| | 2,2,2-TRIFLUOROETHANOL-D3 Basic information |
| Product Name: | 2,2,2-TRIFLUOROETHANOL-D3 | | Synonyms: | 2,2,2-TRIFLUOROETHANOL-D3;2,2,2-TRIFLUOROETHYL-1,1-D2 ALCOHOL;TRIFLUOROETHYL ALCOHOL D2;TRIFLUOROETHYL ALCOHOL D3;TRIFLUOROETHYL-D2 ALCOHOL-D;TRIFLUOROETHANOL-D2;TRIFLUOROETHANOL-D3;[1,1-2H2]-2,2,2-trifluoroetane-1-[2H]ol | | CAS: | 77253-67-9 | | MF: | C2D3F3O | | MW: | 103.06 | | EINECS: | 278-649-6 | | Product Categories: | Alphabetical Listings;NMR - SolventsStable Isotopes;NMR Solvents and Reagents;NMRStable Isotopes;Stable Isotopes | | Mol File: | 77253-67-9.mol |  |
| | 2,2,2-TRIFLUOROETHANOL-D3 Chemical Properties |
| Melting point | -44 °C(lit.) | | Melting point | -44°C | | Boiling point | 77-80°C | | Boiling point | 77-80 °C(lit.) | | density | 1.415 g/mL at 25 °C(lit.) | | density | d = 1,45 | | refractive index | n20/D 1.3(lit.) | | Fp | 85 °F | | storage temp. | Flammables area | | form | Liquid | | Sensitive | Hygroscopic | | InChI | InChI=1S/C2H3F3O/c3-2(4,5)1-6/h6H,1H2/i1D2,6D | | InChIKey | RHQDFWAXVIIEBN-IDPMSXFZSA-N | | SMILES | C(F)(F)(F)C([2H])([2H])O[2H] | | CAS DataBase Reference | 77253-67-9(CAS DataBase Reference) |
| Hazard Codes | Xn,F | | Risk Statements | 10-20/21/22-38-41-48/20 | | Safety Statements | 16-26 | | RIDADR | UN 1987 3/PG 3 | | WGK Germany | 3 | | HazardClass | 3 | | PackingGroup | III | | HS Code | 28459010 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 3 Oral Eye Dam. 1 Flam. Liq. 3 Repr. 1B STOT RE 2 Inhalation |
| | 2,2,2-TRIFLUOROETHANOL-D3 Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | NMR Solvent | | Uses | Recent uses include a gas-phase study of the silaformamide ion and an investigation of substituent effects in photosolvolysis. | | General Description | 2,2,2-Trifluoroethanol-d3 (TFEd3) is 2,2,2-trifluoroethanol in which hydrogen of the –OH group is substituted with deuterium. It is a commonly used 1H NMR and 13C NMR solvent. |
| | 2,2,2-TRIFLUOROETHANOL-D3 Preparation Products And Raw materials |
|