| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Mercapto-5-benzimidazolecarboxylic acid Basic information |
| | 2-Mercapto-5-benzimidazolecarboxylic acid Chemical Properties |
| Melting point | >290℃ | | Boiling point | 413.0±47.0 °C(Predicted) | | density | 1.63 | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | pka | 4.33±0.20(Predicted) | | Appearance | Light brown to brown Solid | | InChI | 1S/C8H6N2O2S/c11-7(12)4-1-2-5-6(3-4)10-8(13)9-5/h1-3H,(H,11,12)(H2,9,10,13) | | InChIKey | DCRZVUIGGYMOBI-UHFFFAOYSA-N | | SMILES | OC(=O)c1ccc2nc(S)[nH]c2c1 | | CAS DataBase Reference | 58089-25-1(CAS DataBase Reference) |
| WGK Germany | WGK 3 | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 2-Mercapto-5-benzimidazolecarboxylic acid Usage And Synthesis |
| | 2-Mercapto-5-benzimidazolecarboxylic acid Preparation Products And Raw materials |
|