|
|
| | 6-METHYLCHRYSENE Basic information |
| Product Name: | 6-METHYLCHRYSENE | | Synonyms: | 6-methyl-chrysen;6-METHYLCHRYSENE;67405 6-METHYLCHRYSENE (PURITY);CHRYSENE,6-METHYL-;6-Methylchrysene@50 μg/mL in Toluene;6-methylquinone;6-Methylchrysene 10.0 μg/ml Acetonitrile;C20890000 6-Methylchrysene | | CAS: | 1705-85-7 | | MF: | C19H14 | | MW: | 242.31 | | EINECS: | 216-942-2 | | Product Categories: | | | Mol File: | 1705-85-7.mol |  |
| | 6-METHYLCHRYSENE Chemical Properties |
| Melting point | 161.5°C | | Boiling point | 465.14°C (rough estimate) | | density | 1.1011 (estimate) | | refractive index | 1.7480 (estimate) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly, Heated) | | form | Solid | | color | Off-White to Pale Yellow | | Water Solubility | 65ug/L(27 ºC) | | Henry's Law Constant | 2.2×100 mol/(m3Pa) at 25℃, Parnis et al. (2015) | | Major Application | general analytical | | InChI | InChI=1S/C19H14/c1-13-12-19-16-8-3-2-6-14(16)10-11-18(19)17-9-5-4-7-15(13)17/h2-12H,1H3 | | InChIKey | ASVDRLYVNFOSCI-UHFFFAOYSA-N | | SMILES | C1=C2C(C3C(C=C2)=C2C(C=CC=C2)=C(C)C=3)=CC=C1 | | IARC | 3 (Vol. Sup 7, 92) 2010 | | EPA Substance Registry System | 6-Methylchrysene (1705-85-7) |
| Hazard Codes | Xn | | Risk Statements | 22-50 | | Safety Statements | 61 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| | 6-METHYLCHRYSENE Usage And Synthesis |
| Uses | 6-Methylchrysene is one of the methylated chrysenes (MeChry), as an aryl hydrocarbon receptor (AhR) agonist. Methylated chrysenes (MeChry) are important cigarette smoke constituents and 6-MeChry has b
een listed as possibly carcinogenic to humans. | | Definition | ChEBI: 6-Methylchrysene is a carbopolycyclic compound. |
| | 6-METHYLCHRYSENE Preparation Products And Raw materials |
|