| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 4-Fluorophenyl methyl sulfone Basic information |
| | 4-Fluorophenyl methyl sulfone Chemical Properties |
| Melting point | 78-81 °C (lit.) | | Boiling point | 95-97°C 7mm | | density | 1.2768 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform, Dichloromethane, Dimethyl Sulfoxide, Methanol | | form | Adhering Crystalline Powder | | color | Almost white | | BRN | 2045674 | | InChI | InChI=1S/C7H7FO2S/c1-11(9,10)7-4-2-6(8)3-5-7/h2-5H,1H3 | | InChIKey | DPJHZJGAGIWXTD-UHFFFAOYSA-N | | SMILES | C1(F)=CC=C(S(C)(=O)=O)C=C1 | | CAS DataBase Reference | 455-15-2(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22 | | Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29309090 | | Storage Class | 11 - Combustible Solids |
| | 4-Fluorophenyl methyl sulfone Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | 4-Fluorophenyl methyl sulfone is used for preparation of substituted indazole amides as glucokinase activators. | | Uses | 4-Fluorophenyl methyl sulfone was used in the preparation of 4-(4′-trifluoromethoxyphenoxy)phenyl methyl sulfone. | | Synthesis | A 500 mL flask was charged with 25.2 g of sodium sulfite, 100 mL of water, and 16.8
g of sodium bicarbonate. Heat to reflux and after all the solids are dissolved, add 21.0 g of 4-fluorobenzenesulfonyl chloride in batches and continue to heat to reflux for 4 hours. Cool to 40
C, 18.9 g of dimethyl sulfate was added dropwise from the dispensing funnel, with a dropwise acceleration to maintain the system temperature at 40~45
is appropriate. After dropping, the reaction was held for 2.5 h. After the methylation reaction was complete, the reaction was heated and refluxed for 1 h. The reaction was then heated and refluxed. Add 200mL of water, static cooling to room temperature, precipitated a large number of solids, filtered, washed with water, that is, p-fluorobenzenesulfone. |
| | 4-Fluorophenyl methyl sulfone Preparation Products And Raw materials |
|