|
|
| | 4,4'-Dinitrostilbene-2,2'-disulfonic acid Basic information |
| Product Name: | 4,4'-Dinitrostilbene-2,2'-disulfonic acid | | Synonyms: | 2,2’-(1,2-ethenediyl)bis(5-nitro-benzenesulfonicaci;2,2’-(1,2-ethenediyl)bis[5-nitro-benzenesulfonicaci;2,2’-(1,2-ethenediyl)bis[5-nitro-Benzenesulfonicacid;4,4’-dinitro-2,2’-stilbenedisulfonicacid;5-nitro-2-[2-(4-nitrophenyl)ethenyl]cyclohexa-2,4-diene-1,1-disulfonic acid;(E)-6,6'-(Ethene-1,2-diyl)bis(3-nitrobenzenesulfonic acid);4' 4" DINITRO STILLBENE 2'2" DISULPHONIC ACID;DNSDA | | CAS: | 128-42-7 | | MF: | C14H10N2O10S2 | | MW: | 430.37 | | EINECS: | 204-885-6 | | Product Categories: | Intermediates of Dyes and Pigments | | Mol File: | 128-42-7.mol |  |
| | 4,4'-Dinitrostilbene-2,2'-disulfonic acid Chemical Properties |
| Melting point | 266 °C | | density | 1.6705 (rough estimate) | | vapor pressure | 0Pa at 25℃ | | refractive index | 1.7000 (estimate) | | storage temp. | 2-8°C | | solubility | 2.629g/L in organic solvents at 20 ℃ | | pka | -1.61±0.45(Predicted) | | Water Solubility | 105.4g/L at 37℃ | | InChI | InChI=1S/C14H10N2O10S2/c17-15(18)11-5-3-9(13(7-11)27(21,22)23)1-2-10-4-6-12(16(19)20)8-14(10)28(24,25)26/h1-8H,(H,21,22,23)(H,24,25,26) | | InChIKey | UETHPMGVZHBAFB-UHFFFAOYSA-N | | SMILES | C(C1=CC=C([N+]([O-])=O)C=C1S(O)(=O)=O)=CC1=CC=C([N+]([O-])=O)C=C1S(O)(=O)=O | | LogP | -0.248 at 37℃ | | CAS DataBase Reference | 128-42-7(CAS DataBase Reference) | | EPA Substance Registry System | Benzenesulfonic acid, 2,2'-(1,2-ethenediyl)bis[5-nitro- (128-42-7) |
| | 4,4'-Dinitrostilbene-2,2'-disulfonic acid Usage And Synthesis |
| Uses | 4,4'-Dinitrostilbene-2,2'-disulfonic acid is used as a chemical intermediate and a precursor of various textile dyes and fluorescent brighteners. It can also react with aniline derivatives to prepare Direct Yellow 12 azo dye. | | Definition | ChEBI: 4,4'-dinitrostilbene-2,2'-disulfonic acid is an arenesulfonic acid. | | Flammability and Explosibility | Non flammable |
| | 4,4'-Dinitrostilbene-2,2'-disulfonic acid Preparation Products And Raw materials |
|