|
|
| | 6-Bromo-4-nitro-1H-indazole Basic information |
| | 6-Bromo-4-nitro-1H-indazole Chemical Properties |
| Boiling point | 420.8±25.0 °C(Predicted) | | density | 1.965 | | storage temp. | Inert atmosphere,Room Temperature | | form | solid | | pka | 9.86±0.40(Predicted) | | Appearance | Light yellow to orange Solid | | InChI | 1S/C7H4BrN3O2/c8-4-1-6-5(3-9-10-6)7(2-4)11(12)13/h1-3H,(H,9,10) | | InChIKey | AHEMYGJJCOXPSP-UHFFFAOYSA-N | | SMILES | Brc1cc2n[nH]cc2c(c1)[N+](=O)[O-] |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | 2811 | | HazardClass | IRRITANT | | PackingGroup | Ⅲ | | HS Code | 2933998090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 6-Bromo-4-nitro-1H-indazole Usage And Synthesis |
| Uses | 6-Bromo-4-nitro-1H-indazole is a reagent in the preparation of 1,2,4-triazine-6-carboxamide derivatives having acetamide group as Syk kinase inhibitors for the treatment of cancer, allergy, or autoimmune diseases. |
| | 6-Bromo-4-nitro-1H-indazole Preparation Products And Raw materials |
|