|
|
| | [(1R,4S)-4-Hydroxy-2-cyclopenten-1-yl]carbamic acid, 1,1-dimethylethyl ester Basic information |
| Product Name: | [(1R,4S)-4-Hydroxy-2-cyclopenten-1-yl]carbamic acid, 1,1-dimethylethyl ester | | Synonyms: | [(1R,4S)-4-Hydroxy-2-cyclopenten-1-yl]carbamic acid tert-butyl ester;(1R,4S)-4-hydroxy-1-n-tertbutoxycarboxy-,2-cyclope;(1R,4S)-4-HYDROXY-1-N-TERT-BUTOXYCARBOXY-2-CYCLOPENTENAMINE;Carbamic acid, [(1R,4S)-4-hydroxy-2-cyclopenten-1-yl]-, 1,1-dimethylethyl;(1R,4S)-(4-Hydroxy-cyclopent-2-enyl)-carbamic acid tert-butyl ester;tert-butyl N-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]carbamate;tert-Butyl ((1R,4S)-4-hydroxycyclopent-2-en-1-yl)carbamate;-4-hydroxycyclopent-2-en-1-yl) | | CAS: | 189625-12-5 | | MF: | C10H17NO3 | | MW: | 199.25 | | EINECS: | | | Product Categories: | N-BOC | | Mol File: | 189625-12-5.mol | ![[(1R,4S)-4-Hydroxy-2-cyclopenten-1-yl]carbamic acid, 1,1-dimethylethyl ester Structure](CAS/GIF/189625-12-5.gif) |
| | [(1R,4S)-4-Hydroxy-2-cyclopenten-1-yl]carbamic acid, 1,1-dimethylethyl ester Chemical Properties |
| Melting point | 56-58 °C(Solv: ethyl acetate (141-78-6); hexane (110-54-3)) | | Boiling point | 325.6±42.0 °C(Predicted) | | density | 1.11±0.1 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 11.87±0.40(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C10H17NO3/c1-10(2,3)14-9(13)11-7-4-5-8(12)6-7/h4-5,7-8,12H,6H2,1-3H3,(H,11,13)/t7-,8+/m0/s1 | | InChIKey | UWWUTEZECIYOCW-JGVFFNPUSA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@@H]1C[C@H](O)C=C1 |
| | [(1R,4S)-4-Hydroxy-2-cyclopenten-1-yl]carbamic acid, 1,1-dimethylethyl ester Usage And Synthesis |
| | [(1R,4S)-4-Hydroxy-2-cyclopenten-1-yl]carbamic acid, 1,1-dimethylethyl ester Preparation Products And Raw materials |
|