1,4-DIIODO-2,5-DIMETHYLBENZENE manufacturers
|
| | 1,4-DIIODO-2,5-DIMETHYLBENZENE Basic information |
| Product Name: | 1,4-DIIODO-2,5-DIMETHYLBENZENE | | Synonyms: | 2,5-DIIODO-P-XYLENE;2,5-DIIODO-1,4-XYLENE;1,4-DIIODO-2,5-DIMETHYLBENZENE;Benzene,1,4-diiodo-2,5-dimethyl-;1,4-DIIODO-2,5-DIMETHYLBE;1,4-Diiodo-2,5-dimethylbenzene - [D94557] | | CAS: | 1124-08-9 | | MF: | C8H8I2 | | MW: | 357.96 | | EINECS: | | | Product Categories: | | | Mol File: | 1124-08-9.mol |  |
| | 1,4-DIIODO-2,5-DIMETHYLBENZENE Chemical Properties |
| Melting point | 103-104 | | Boiling point | 306.2±37.0 °C(Predicted) | | density | 2.154±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Toluene | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C8H8I2/c1-5-3-8(10)6(2)4-7(5)9/h3-4H,1-2H3 | | InChIKey | WJYYUEQVECTILJ-UHFFFAOYSA-N | | SMILES | C1(I)=CC(C)=C(I)C=C1C |
| Hazard Codes | Xi | | Hazard Note | Irritant | | HS Code | 2902900000 |
| | 1,4-DIIODO-2,5-DIMETHYLBENZENE Usage And Synthesis |
| | 1,4-DIIODO-2,5-DIMETHYLBENZENE Preparation Products And Raw materials |
|