| Company Name: |
Cochemical Ltd. |
| Tel: |
029-86115547 17791676824 |
| Email: |
sales@cochemical.com |
|
| | 3,6-Difluoro-2-methoxybenzoic acid Basic information |
| | 3,6-Difluoro-2-methoxybenzoic acid Chemical Properties |
| Melting point | 82-83 °C(Solv: water (7732-18-5)) | | Boiling point | 266.4±35.0 °C(Predicted) | | density | 1.399±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 2.82±0.10(Predicted) | | InChI | InChI=1S/C8H6F2O3/c1-13-7-5(10)3-2-4(9)6(7)8(11)12/h2-3H,1H3,(H,11,12) | | InChIKey | LFXJCALGZMNDHA-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=C(F)C=CC(F)=C1OC |
| Hazard Codes | Xi | | Hazard Note | Irritant | | HS Code | 2918999090 |
| | 3,6-Difluoro-2-methoxybenzoic acid Usage And Synthesis |
| | 3,6-Difluoro-2-methoxybenzoic acid Preparation Products And Raw materials |
|