| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:Triphenyl-d15-phosphine oxide CAS:54964-93-1
|
| Company Name: |
Riedel-de Haen AG
|
| Tel: |
800 558-9160 |
| Email: |
|
| Products Intro: |
CAS:54964-93-1
|
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Email: |
|
| Products Intro: |
|
|
| | TRIPHENYL-D15-PHOSPHINE OXIDE Basic information |
| | TRIPHENYL-D15-PHOSPHINE OXIDE Chemical Properties |
| Melting point | 150-157 °C | | Fp | 180 °C | | form | solid | | InChI | 1S/C18H15OP/c19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D,13D,14D,15D | | InChIKey | FIQMHBFVRAXMOP-KLHTYYPYSA-N | | SMILES | O=P(C1=C([2H])C([2H])=C([2H])C([2H])=C1[2H])(C2=C([2H])C([2H])=C([2H])C([2H])=C2[2H])C3=C([2H])C([2H])=C([2H])C([2H])=C3[2H] |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | TRIPHENYL-D15-PHOSPHINE OXIDE Usage And Synthesis |
| Uses | Triphenylphosphine Oxide-d15, is the labeled analogue of Triphenylphosphine Oxide (T808980), (Orlistat USP Related Compound C) and a catalyst in the conversion of aldehydes into 1,1-dichlorides. Triphenylphosphine Oxide is used as a catalyst for the synthesis of hightly functionalized α-CF3 γ-keto esters. |
| | TRIPHENYL-D15-PHOSPHINE OXIDE Preparation Products And Raw materials |
|