| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | Tri(phenyl-d5)phosphine Basic information |
| Product Name: | Tri(phenyl-d5)phosphine | | Synonyms: | TRI(PHENYL-D5)PHOSPHINE, 99 ATOM % D;tris(2,3,4,5,6-pentadeuteriophenyl)phosphane;TRIPHENYLPHOSPHINE-D15;TRIPHENYLPHOSPHINE (D15, 99%);Triphenylphosphine-d15 99 atom % D;Triphenylphosphine-d15Q: What is
Triphenylphosphine-d15 Q: What is the CAS Number of
Triphenylphosphine-d15;Triphenylphosphine-d15 in acetonitrile;Triphenylphosphine-d15 | | CAS: | 24762-44-5 | | MF: | C18D15P | | MW: | 277.38 | | EINECS: | | | Product Categories: | Alphabetical Listings;Stable Isotopes | | Mol File: | 24762-44-5.mol |  |
| | Tri(phenyl-d5)phosphine Chemical Properties |
| Melting point | 79-81 °C (lit.) | | Boiling point | 377 °C | | Fp | 220℃ | | storage temp. | Room Temperature | | solubility | Chloroform (Slightly), Hexanes (Slightly) | | form | Solid | | color | White to Off-White | | InChI | 1S/C18H15P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D,13D,14D,15D | | InChIKey | RIOQSEWOXXDEQQ-KLHTYYPYSA-N | | SMILES | [2H]c1c([2H])c([2H])c(c([2H])c1[2H])P(c2c([2H])c([2H])c([2H])c([2H])c2[2H])c3c([2H])c([2H])c([2H])c([2H])c3[2H] | | CAS Number Unlabeled | 603-35-0 |
| Hazard Codes | Xn,N | | Risk Statements | 20/21/22-36/37/38-50/53 | | Safety Statements | 45-61-60 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Skin Sens. 1B
STOT RE 1 Inhalation |
| | Tri(phenyl-d5)phosphine Usage And Synthesis |
| Uses | Triphenylphosphine-d15 is the labelled version of Triphenylphosphine (T808975) which is used in the synthesis of Chlorambucil with cytotoxicity in breast and pancreatic cancers. Triphenylphosphine is also used in the preparation of α-Tocopherol analogues for monitoring antioxidant status. | | Uses | Employed in a mechanistic study of cis-bis(silylmethyl)platinum(II) complexes. |
| | Tri(phenyl-d5)phosphine Preparation Products And Raw materials |
|