|
|
| | 6,7-Dimethoxy-1,2,3,4-tetrahydro-isoquinoline-3-carboxylic acid Basic information |
| Product Name: | 6,7-Dimethoxy-1,2,3,4-tetrahydro-isoquinoline-3-carboxylic acid | | Synonyms: | TIMTEC-BB SBB011756;Albb-005267;3-Isoquinolinecarboxylic acid, 1,2,3,4-tetrahydro-6,7-dimethoxy-;6,7-Dimethoxy-1,2,3,4-tetrahydro-isoquinoline-3-carboxylic acid | | CAS: | 76824-86-7 | | MF: | C12H15NO4 | | MW: | 237.25 | | EINECS: | | | Product Categories: | pharmacetical | | Mol File: | 76824-86-7.mol |  |
| | 6,7-Dimethoxy-1,2,3,4-tetrahydro-isoquinoline-3-carboxylic acid Chemical Properties |
| Boiling point | 434.8±45.0 °C(Predicted) | | density | 1.232±0.06 g/cm3(Predicted) | | form | solid | | pka | 2.15±0.20(Predicted) | | InChI | 1S/C12H15NO4/c1-16-10-4-7-3-9(12(14)15)13-6-8(7)5-11(10)17-2/h4-5,9,13H,3,6H2,1-2H3,(H,14,15) | | InChIKey | BWYXEHBJIMGDEB-UHFFFAOYSA-N | | SMILES | COc1cc2CNC(Cc2cc1OC)C(O)=O |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 6,7-Dimethoxy-1,2,3,4-tetrahydro-isoquinoline-3-carboxylic acid Usage And Synthesis |
| | 6,7-Dimethoxy-1,2,3,4-tetrahydro-isoquinoline-3-carboxylic acid Preparation Products And Raw materials |
|