| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 6-beta-Naltrexol HCl Basic information |
| Product Name: | 6-beta-Naltrexol HCl | | Synonyms: | -NALTREXOL;17-(Cyclopropylmethyl)-4,5-epoxy-(5a,6b)-morphinan-3,6,14-triol;6b-Hydroxynaltrexone;6b-Naltrexo;b-Naltrexol;6 beta-hydroxynaltrexone;(5a,6a)-17-(Cyclopropylmethyl)-4,5-epoxy-morphinan-3,6,14-triol;17-(Cyclopropylmethyl)-4,5a-epoxy-morphinan-3,6a,14-triol | | CAS: | 49625-89-0 | | MF: | C20H25NO4 | | MW: | 343.42 | | EINECS: | | | Product Categories: | Metabolite Reference Standard;Isotope Labelled Compounds;Intermediates & Fine Chemicals;Metabolites & Impurities;Pharmaceuticals;Various Metabolites and Impurities | | Mol File: | 49625-89-0.mol |  |
| | 6-beta-Naltrexol HCl Chemical Properties |
| Melting point | 90-96C | | Boiling point | 557.5±50.0 °C(Predicted) | | density | 1.48±0.1 g/cm3(Predicted) | | Fp | 9℃ | | storage temp. | Refrigerator | | pka | 9.39±0.60(Predicted) | | form | liquid | | Major Application | forensics and toxicology | | InChI | 1S/C20H25NO4/c22-13-4-3-12-9-15-20(24)6-5-14(23)18-19(20,16(12)17(13)25-18)7-8-21(15)10-11-1-2-11/h3-4,11,14-15,18,22-24H,1-2,5-10H2/t14-,15-,18+,19+,20-/m1/s1 | | InChIKey | JLVNEHKORQFVQJ-PYIJOLGTSA-N | | SMILES | OC1=C(O2)C([C@]([C@@H]2[C@H](O)CC3)(CCN4CC5CC5)[C@]3(O)[C@H]4C6)=C6C=C1 |
| Hazard Codes | F,T | | Risk Statements | 11-23/24/25-39/23/24/25 | | Safety Statements | 16-36/37-45 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | 6-beta-Naltrexol HCl Usage And Synthesis |
| Chemical Properties | Light Yellow Solid | | Uses | A metabolite of Naltrexone. Narcotic antagonist | | Uses | An isotope Labelled metabolite of Naltrexone. Narcotic antagonist. | | Definition | ChEBI: 6alpha-Naltrexol is a member of phenanthrenes. |
| | 6-beta-Naltrexol HCl Preparation Products And Raw materials |
|