|
|
| | 1,3,3-Trimethylindolinonaphthospirooxazine Basic information |
| Product Name: | 1,3,3-Trimethylindolinonaphthospirooxazine | | Synonyms: | 1,3-DIHYDRO-1,3,3-TRIMETHYLSPIRO[2H-INDOLE-2,3'-[3H]NAPHTH[2,1-B][1,4] OXAZINE];1,3,3-TRIMETHYLINDOLINONAPHTHOSPIROOXAZINE;1,3,3-TRIMETHYLSPIRO[INDOLINE-2,3'-[3H]NAPHTH[2,1-B][1,4]OXAZINE];PHOTOROME I;Trimethylindolinonaphthospirooxazine;1,3-DIHYDRO-1,3,3-TRIMETHYLSPIRO(INDOLE- 2,3'-(3H)NAPHTH(2,1B)(1,4)OXAZINE);1,3,3-Trimethylspiro[indoline-2,3'-naphtho[2,1-b][1,4]oxazine];1,3,3-TRIMETHYLINDOLINONAPHTHOSPIROOXAZINE 98+% | | CAS: | 27333-47-7 | | MF: | C22H20N2O | | MW: | 328.41 | | EINECS: | 404-480-6 | | Product Categories: | Functional Materials;Photochromic Compounds;Spiropyrans (Photochromic) | | Mol File: | 27333-47-7.mol |  |
| | 1,3,3-Trimethylindolinonaphthospirooxazine Chemical Properties |
| Melting point | 128-130 °C(lit.) | | Boiling point | 529.1±50.0 °C(Predicted) | | density | 1.19 | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Toluene,Benzene | | form | powder to crystal | | pka | 3.26±0.40(Predicted) | | color | White to Orange to Green | | InChI | InChI=1S/C22H20N2O/c1-21(2)17-10-6-7-11-18(17)24(3)22(21)14-23-20-16-9-5-4-8-15(16)12-13-19(20)25-22/h4-14H,1-3H3 | | InChIKey | CQTRKDFIQFOAQV-UHFFFAOYSA-N | | SMILES | N1(C)C2=C(C=CC=C2)C(C)(C)C21C=NC1=C3C(C=CC=C3)=CC=C1O2 | | CAS DataBase Reference | 27333-47-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 29349990 |
| | 1,3,3-Trimethylindolinonaphthospirooxazine Usage And Synthesis |
| Uses | Photorome I is a photochromic dye that can be used as a smart colorant for a variety of applications which include optical switches, printing materials, and ophthalmic lenses. | | General Description | 1,3-Dihydro-1,3,3-trimethylspiro[2H-indole-2,3′-[3H]naphth[2,1-b][1,4]oxazine] (Photorome I) is an organic photochromic material that is used as a spirooxazine dye for use in molecular electronics. This dye changes to blue on irradiating with UV light. |
| | 1,3,3-Trimethylindolinonaphthospirooxazine Preparation Products And Raw materials |
|