|
|
| | 1-Methyl-4-(2-methylphenyl)-1,2,3,6-tetrahydropyridine hydrochloride Basic information |
| | 1-Methyl-4-(2-methylphenyl)-1,2,3,6-tetrahydropyridine hydrochloride Chemical Properties |
| solubility | H2O: soluble | | form | solid | | color | white | | Water Solubility | H2O: soluble ethanol: soluble | | InChI | 1S/C13H17N.ClH/c1-11-5-3-4-6-13(11)12-7-9-14(2)10-8-12;/h3-7H,8-10H2,1-2H3;1H | | InChIKey | QLIQCKBPYIWPTE-UHFFFAOYSA-N | | SMILES | Cl[H].CN1CCC(=CC1)c2ccccc2C |
| Hazard Codes | T | | Risk Statements | 25-39/23/24/25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1/PG 2 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 1-Methyl-4-(2-methylphenyl)-1,2,3,6-tetrahydropyridine hydrochloride Usage And Synthesis |
| Uses | 1-Methyl-4-(2μ-methylphenyl)-1,2,3,6-tetrahydropyridine hydrochloride has been used to study its effect on core temperature in C57BL/6J mice. | | Biological Activity | 1-Methyl-4-(2μ-methylphenyl)-1,2,3,6-tetrahydropyridine hydrochloride (MPTP) is a tertiary amine. It is widely used to induce experimental parkinsonism in mice. |
| | 1-Methyl-4-(2-methylphenyl)-1,2,3,6-tetrahydropyridine hydrochloride Preparation Products And Raw materials |
|