1,3-BIS(DIMETHYLAMINO)-2-PROPANOL manufacturers
|
| | 1,3-BIS(DIMETHYLAMINO)-2-PROPANOL Basic information |
| Product Name: | 1,3-BIS(DIMETHYLAMINO)-2-PROPANOL | | Synonyms: | 1,3-Bis(dimethylamino)-2-hydroxypropane;1,3-Bis(dimethylamino)propane-2-ol;N,N,N',N'-Tetramethyl-2-hydroxy-1,3-propanediamine;1,3-Bis(dimethylamino)-2-propanol,95%;1,3-Bis(dimethylamino)-2-propanol,N,N,N′,N′-Tetramethyl-1,3-diamino-2-propanol;1,3-bis(dimethylamino)-2-propano;1,3-Bis(dimethylamino)isopropanol;1,3-bis-dimethylamino-propan-2-ol | | CAS: | 5966-51-8 | | MF: | C7H18N2O | | MW: | 146.23 | | EINECS: | 227-754-5 | | Product Categories: | | | Mol File: | 5966-51-8.mol |  |
| | 1,3-BIS(DIMETHYLAMINO)-2-PROPANOL Chemical Properties |
| Melting point | 120-124 °C | | Boiling point | 265.87°C (rough estimate) | | density | 0.897 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.4422(lit.) | | Fp | >230 °F | | pka | 14.58±0.20(Predicted) | | form | liquid | | InChI | InChI=1S/C7H18N2O/c1-8(2)5-7(10)6-9(3)4/h7,10H,5-6H2,1-4H3 | | InChIKey | JGVZJRHAZOBPMW-UHFFFAOYSA-N | | SMILES | C(N(C)C)C(O)CN(C)C | | EPA Substance Registry System | 2-Propanol, 1,3-bis(dimethylamino)- (5966-51-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | RTECS | UA7370000 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,3-BIS(DIMETHYLAMINO)-2-PROPANOL Usage And Synthesis |
| | 1,3-BIS(DIMETHYLAMINO)-2-PROPANOL Preparation Products And Raw materials |
|