| Company Name: |
Shanghai Chiral Chemicals Inc. Gold
|
| Tel: |
021-37285021 13472570865 |
| Email: |
tym7xi@aliyun.com |
| Products Intro: |
CAS:74094-05-6
Purity:95% Package:1kg;25kg
|
|
| | D-LACTIC ACID-BENZYL ESTER Basic information |
| Product Name: | D-LACTIC ACID-BENZYL ESTER | | Synonyms: | D-LACTIC ACID-BENZYL ESTER;H-D-Lac-OBzl;Benzyl (R)-Lactate;Propanoic acid, 2-hydroxy-, phenylmethyl ester, (2R)-;(R)-2-Phenylmethyl hydroxypropanoate;(R)-lactic acid benzyl ester;benzyl (2R)-2-hydroxypropanoate;Perindopril Impurity 95 | | CAS: | 74094-05-6 | | MF: | C10H12O3 | | MW: | 180.2 | | EINECS: | | | Product Categories: | | | Mol File: | 74094-05-6.mol |  |
| | D-LACTIC ACID-BENZYL ESTER Chemical Properties |
| Boiling point | 280.5±15.0 °C(Predicted) | | density | 1.150±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 13.03±0.20(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C10H12O3/c1-8(11)10(12)13-7-9-5-3-2-4-6-9/h2-6,8,11H,7H2,1H3/t8-/m1/s1 | | InChIKey | ZYTLPUIDJRKAAM-MRVPVSSYSA-N | | SMILES | C(OCC1=CC=CC=C1)(=O)[C@H](O)C |
| | D-LACTIC ACID-BENZYL ESTER Usage And Synthesis |
| | D-LACTIC ACID-BENZYL ESTER Preparation Products And Raw materials |
|