| Company Name: |
Syntechem Co.,Ltd
|
| Tel: |
|
| Email: |
info@syntechem.com |
| Products Intro: |
Product Name:3',5'-dichloro-[1,1'-biphenyl]-4-aMine
CAS:405058-01-7
Purity:97% Package:1g;5g;25g;100g;250g;1kg;5kg;10kg;25kg Remarks:we offer low price custom synthesis and contract manufacturing
|
|
| | 4-AMINO-3',5'-DICHLOROBIPHENYL Basic information |
| Product Name: | 4-AMINO-3',5'-DICHLOROBIPHENYL | | Synonyms: | 3',5'-DICHLORO-BIPHENYL-4-YLAMINE HYDROCHLORIDE;4-(3,5-DICHLOROPHENYL)ANILINE;4-AMINO-3',5'-DICHLOROBIPHENYL;4-(3,5-Dichlorophenyl)aniline, 3',5'-Dichloro-[1,1'-biphenyl]-4-amine;[1,1'-Biphenyl]-4-amine, 3',5'-dichloro-;3',5'-Dichloro-[1,1'-biphenyl]-4-amine | | CAS: | 405058-01-7 | | MF: | C12H9Cl2N | | MW: | 238.11 | | EINECS: | | | Product Categories: | | | Mol File: | 405058-01-7.mol |  |
| | 4-AMINO-3',5'-DICHLOROBIPHENYL Chemical Properties |
| Boiling point | 370.6±27.0 °C(Predicted) | | density | 1.316±0.06 g/cm3(Predicted) | | pka | 4.15±0.10(Predicted) | | form | solid | | InChI | 1S/C12H9Cl2N/c13-10-5-9(6-11(14)7-10)8-1-3-12(15)4-2-8/h1-7H,15H2 | | InChIKey | IELLSGLWKOTCFM-UHFFFAOYSA-N | | SMILES | NC(C=C1)=CC=C1C2=CC(Cl)=CC(Cl)=C2 |
| Hazard Codes | Xi | | Risk Statements | 41 | | Safety Statements | 26-39 | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HS Code | 2921420090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1 |
| | 4-AMINO-3',5'-DICHLOROBIPHENYL Usage And Synthesis |
| | 4-AMINO-3',5'-DICHLOROBIPHENYL Preparation Products And Raw materials |
|