3,6-Dichlorocarbazole manufacturers
- 3,6-DICHLOROCARBAZOLE
-
- $6.60
-
2020-01-08
- CAS:5599-71-3
- Min. Order: 1KG
- Purity: 98%-99%
- Supply Ability: 1kg-1000kg
|
| | 3,6-Dichlorocarbazole Basic information |
| | 3,6-Dichlorocarbazole Chemical Properties |
| Melting point | 207-208 | | Boiling point | 420.0±25.0 °C(Predicted) | | density | 1.476±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | 2-8°C, protect from light | | solubility | soluble in Acetone | | form | powder to crystal | | pka | 15.52±0.30(Predicted) | | color | White to Light yellow to Light orange | | InChI | InChI=1S/C12H7Cl2N/c13-7-1-3-11-9(5-7)10-6-8(14)2-4-12(10)15-11/h1-6,15H | | InChIKey | BIMDTNQPZWJKPL-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(Cl)C=C2)C2=C1C=CC(Cl)=C2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | Hazard Note | Irritant | | HS Code | 2933.99.8290 |
| | 3,6-Dichlorocarbazole Usage And Synthesis |
| Uses | 3,6-Dichloro-9H-carbazole is a standard for environmental testing and research. An aryl hydrocarbon receptor agonist. Substance for the characterization and biological potency of mono- to tetra-halogenated carbazoles. |
| | 3,6-Dichlorocarbazole Preparation Products And Raw materials |
|