| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (-)-Camphene Basic information |
| Product Name: | (-)-Camphene | | Synonyms: | 2,2-dimethyl-3-methylene-,(1S)-Bicyclo[2.2.1]heptane;2-dimethyl-3-methylene-(1s)-bicyclo[2.2.1]heptan;L-Camphene;(1S)-2,2-DIMETHYL-3-METHYLENEBICYCLO[2.2.1]HEPTANE;Bicyclo2.2.1heptane, 2,2-dimethyl-3-methylene-, (1S,4R)-;(1R,4S)-3,3-Dimethyl-2-methylenebicyclo[2.2.1]heptane;(1S,4R)-2,2-Dimethyl-3-methylenenorbornane;[1S,4R,(-)]-2,2-Dimethyl-3-methylenebicyclo[2.2.1]heptane | | CAS: | 5794-04-7 | | MF: | C10H16 | | MW: | 136.23 | | EINECS: | 227-337-8 | | Product Categories: | | | Mol File: | 5794-04-7.mol |  |
| | (-)-Camphene Chemical Properties |
| Melting point | 36-38 °C(lit.) | | Boiling point | 157.5-158.5 °C(lit.) | | density | 0.84 g/mL at 25 °C(lit.) | | refractive index | 1.4562 (estimate) | | Fp | 98 °F | | solubility | Benzene (Slightly), Chloroform (Sparingly) | | form | Solid | | color | White to Off-White Waxy | | Odor | at 10.00 % in dipropylene glycol. fresh woody fir terpene | | Odor Type | woody | | Optical Rotation | [α]20/D -48°, c =4 in ethanol
[α]25/D -35 to -43°, c =4 in ethanol | | Merck | 14,1730 | | Stability: | Volatile | | InChI | 1S/C10H16/c1-7-8-4-5-9(6-8)10(7,2)3/h8-9H,1,4-6H2,2-3H3/t8-,9+/m1/s1 | | InChIKey | CRPUJAZIXJMDBK-BDAKNGLRSA-N | | SMILES | CC1(C)[C@H]2CC[C@H](C2)C1=C | | LogP | 4.239 (est) | | EPA Substance Registry System | Bicyclo[2.2.1]heptane, 2,2-dimethyl-3-methylene-, (1S,4R)- (5794-04-7) |
| Hazard Codes | F | | Risk Statements | 11-10 | | Safety Statements | 16-33-29 | | RIDADR | UN 1325 4.1/PG 2 | | WGK Germany | 3 | | RTECS | EX1055000 | | TSCA | TSCA listed | | HazardClass | 4.1 | | PackingGroup | III | | Storage Class | 4.1B - Flammable solid hazardous materials | | Hazard Classifications | Flam. Sol. 1 |
| | (-)-Camphene Usage And Synthesis |
| Uses | (-)-Camphene has been observed in the chemical composition of essential oils from different morphological parts of Pinus cembra L. | | Definition | ChEBI: A camphene (2,2-dimethyl-3-methylenebicyclo[2.2.1]heptane) that has S configuration at position 1 and R configuration at position 4. | | Purification Methods | Purify norbornane by fractionation through a Stedman column (see p. 11) at 100mm in a N2 atmosphere, crystallise it from EtOH and sublime it in a vacuum below its melting point. It is characterised by its camphenilone semicarbazone, m 217-218.5o, or camphor semicarbazone, m 236-238o. [NMR: Hana & Koch Chem Ber 111 2527 1978, Bartlett et al. Justus Liebigs Ann Chem 623 217 1959, Bain et al. J Am Chem Soc 72 3124 1950, Beilstein 5 IV 461.] |
| | (-)-Camphene Preparation Products And Raw materials |
|