|
|
| | 2-Amino-4-(trifluoromethoxy)phenol Basic information |
| | 2-Amino-4-(trifluoromethoxy)phenol Chemical Properties |
| storage temp. | 2-8°C(protect from light) | | form | solid | | color | Dark brown to black | | InChI | InChI=1S/C7H6F3NO2/c8-7(9,10)13-4-1-2-6(12)5(11)3-4/h1-3,12H,11H2 | | InChIKey | DNYJUUSAYDJKAF-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(OC(F)(F)F)C=C1N |
| Hazard Codes | Xi | | Hazard Note | Irritant | | HS Code | 2922290090 |
| | 2-Amino-4-(trifluoromethoxy)phenol Usage And Synthesis |
| Uses |
2-amino-4-(trifluoromethoxy)phenol is a phenolic organic compound and can be used in organic synthesis and experimental research.
|
| | 2-Amino-4-(trifluoromethoxy)phenol Preparation Products And Raw materials |
|