| Company Name: |
Nextpeptide Inc |
| Tel: |
+86-0571-81612335 +8613336028439 |
| Email: |
sales@nextpeptide.com |
|
| | TFA-Phe-OMe Basic information |
| Product Name: | TFA-Phe-OMe | | Synonyms: | Trifluoroacetyzl L-phenylalanine methyl ester;Alanine, 3-phenyl-N-(trifluoroacetyl)-, methyl ester;Alanine, 3-phenyl-N-(trifluoroacetyl)-, methyl ester, L-;L-Phenylalanine, N-(trifluoroacetyl)-, methyl ester;Methyl 3-phenyl-2-[(trifluoroacetyl)amino]propanoate;N-ALPHA-TRIFLUOROACETYL-L-PHENYLALANINE METHYL ESTER;N-TFA-L-PHENYLALANINE METHYL ESTER;TRIFLUOROACETYL L-PHENYLALANINE METHYL ESTER | | CAS: | 23635-30-5 | | MF: | C12H12F3NO3 | | MW: | 275.22 | | EINECS: | | | Product Categories: | I - Z;Modified Amino Acids;Amino Acids | | Mol File: | 23635-30-5.mol |  |
| | TFA-Phe-OMe Chemical Properties |
| Melting point | 50-52 °C | | Boiling point | 112 °C(Press: 3-4 Torr) | | density | 1.283±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 9.67±0.46(Predicted) | | InChI | 1S/C12H12F3NO3/c1-19-10(17)9(16-11(18)12(13,14)15)7-8-5-3-2-4-6-8/h2-6,9H,7H2,1H3,(H,16,18) | | InChIKey | ZYMGRJXIRUWDLX-UHFFFAOYSA-N | | SMILES | COC(=O)C(Cc1ccccc1)NC(=O)C(F)(F)F |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | TFA-Phe-OMe Usage And Synthesis |
| | TFA-Phe-OMe Preparation Products And Raw materials |
|