| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
Dehydroergosterol manufacturers
|
| | Dehydroergosterol Basic information |
| Product Name: | Dehydroergosterol | | Synonyms: | ergosta-5,7,9(11),22-tetraen-3B-ol;ERGOSTA-5,7,9(11),22-TETRAEN-3BETA-OL;Ergosta-5,7,9(11),22-tetraen-3-ol, (3β,22E)-;Ergosta-5,7,9(11),22-tetraen-3β-ol;Ergosta-5,7,9(11),22-tetren-3β-ol;delta(5,7,9(11)22)-Ergostatetraen-3-ol;Ergosta-5,7,9(11),22-tetraen-3-ol, (3beta,22E)-;dehydroergosterol (DHE) | | CAS: | 516-85-8 | | MF: | C28H42O | | MW: | 394.63 | | EINECS: | | | Product Categories: | | | Mol File: | 516-85-8.mol |  |
| | Dehydroergosterol Chemical Properties |
| Melting point | 146° | | alpha | D15 +149.2° (c = 1.9 in chloroform) | | Boiling point | bp0.5 230° | | density | 0.9894 (rough estimate) | | refractive index | 1.5100 (estimate) | | storage temp. | -70°C | | solubility | Acetone (Slightly), Chloroform (Slightly) | | pKa | 14.88±0.70(Predicted) | | form | Solid | | color | Off-White to Pale Yellow | | Stability: | Light Sensitive | | InChIKey | QSVJYFLQYMVBDR-CMNOFMQQSA-N | | SMILES | [H][C@@]1(CC[C@@]2([H])C3=CC=C4C[C@@H](O)CC[C@]4(C)C3=CC[C@]12C)[C@H](C)\C=C\[C@H](C)C(C)C |
| Hazard Codes | Xn | | Risk Statements | 40 | | Safety Statements | 36/37 | | WGK Germany | 2 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Carc. 2
STOT RE 2 |
| | Dehydroergosterol Usage And Synthesis |
| Uses | Dehydroergosterol (DHE) is suitable for the transfer of DHE from a population of donor (LD) to acceptor (LA) liposomes. | | Uses | A fluorescent cholesterol analog useful as a probe in membrane research. | | Definition | ChEBI: A phytosterol consiting of ergostane having double bonds at the 5,6-, 7,8- 9,11- and 22,23-positions as well as a 3beta-hydroxy group. | | General Description | Dehydroergosterol (DHE) is a fluorescent sterol that possesses similar biophysical properties as cholesterol. It is found in yeast cells and other fungi. | | Biochem/physiol Actions | Dehydroergosterol (DHE) is used for the visualization of intracellular traffic and intracellular transport kinetics. |
| | Dehydroergosterol Preparation Products And Raw materials |
|