BCN-Osu manufacturers
- BCN-Osu
-
-
2026-08-11
- CAS:1426827-79-3
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1000kgs
- endo-BCN-NHS ester
-
-
2025-06-07
- CAS:1426827-79-3
- Min. Order: 50mg
- Purity: >95.00%
- Supply Ability: 250
- BCN-Osu
-
-
2023-05-26
- CAS:1426827-79-3
- Min. Order: 100mg
- Purity: 95%
- Supply Ability: 1kg
|
| | BCN-Osu Basic information |
| Product Name: | BCN-Osu | | Synonyms: | BCN-Osu;(1R,8S,9S)-BICYCLO[6.1.0]NON-4-YN-9-YLMETHYL?SUCCINIMIDYL?CARBONATE/BCN-Osu MFCD19705416;Carbonic acid, (1α,8α,9β)-bicyclo[6.1.0]non-4-yn-9-ylmethyl 2,5-dioxo-1-pyrrolidinyl ester;Click-easy? BCN N-hydroxysuccinimide ester
I;(1R,8S,9s)-Bicyclo[6.1.0]non-4-yn-9-ylmethyl Succinimidyl Carbonate (2mg*5);[(1R,8S,9s)-Bicyclo[6.1.0]non-4-yn-9-yl]methyl (2,5-Dioxopyrrolidin-1-yl) Carbonate;BCN-CO-NHS;endo-BCN-NHS ester | | CAS: | 1426827-79-3 | | MF: | C15H17NO5 | | MW: | 291.3 | | EINECS: | | | Product Categories: | SiChem;BCN | | Mol File: | 1426827-79-3.mol |  |
| | BCN-Osu Chemical Properties |
| Melting point | 120 °C | | Boiling point | 412.8±28.0 °C(Predicted) | | density | 1.35±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | water: insoluble | | form | powder | | color | White to light yellow | | InChI | InChI=1/C15H17NO5/c17-13-7-8-14(18)16(13)21-15(19)20-9-12-10-5-3-1-2-4-6-11(10)12/h10-12H,3-9H2/t10-,11+,12- | | InChIKey | SKTDJYHCSCYLQU-ZSBIGDGJNA-N | | SMILES | C([C@@H]1[C@]2([H])CCC#CCC[C@]12[H])OC(=O)ON1C(CCC1=O)=O |&1:1,2,10,r| |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | BCN-Osu Usage And Synthesis |
| Description | (1R,8S,9s)-Bicyclo[6.1.0]non-4-yn-9-ylmethyl Succinimidyl Carbonate is a Succinimidyl ester/NHS functionalized cyclooctyne derivative for the addition of the cyclooctyne moiety into amine containing compounds or biomolecules. The BCN group can react with azide-tagged biomolecules under copper free condition. | | Uses | endo-BCN-NHS carbonate contains BCN group. Strain-promoted alkyne-azide cycloaddition (SPAAC) can also occur with molecules containing DBCO or BCN groups. | | reaction suitability | reaction type: click chemistry
reagent type: cross-linking reagent |
| | BCN-Osu Preparation Products And Raw materials |
|