| Company Name: |
Syntechem Co.,Ltd. Gold |
| Tel: |
519-88298820 15861130028 |
| Email: |
info@syntechem.com |
|
| | 1-ETHYL-3-METHYL-1H-PYRAZOLE-5-CARBOXYLIC ACID Basic information |
| | 1-ETHYL-3-METHYL-1H-PYRAZOLE-5-CARBOXYLIC ACID Chemical Properties |
| Melting point | 130 °C | | Boiling point | 308.5±22.0 °C(Predicted) | | density | 1.23±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 3.27±0.10(Predicted) | | color | White to Light yellow | | InChI | InChI=1S/C7H10N2O2/c1-3-9-6(7(10)11)4-5(2)8-9/h4H,3H2,1-2H3,(H,10,11) | | InChIKey | VFMGOJUUTAPPDA-UHFFFAOYSA-N | | SMILES | N1(CC)C(C(O)=O)=CC(C)=N1 | | CAS DataBase Reference | 50920-65-5(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | RTECS | UQ6407500 | | HazardClass | IRRITANT | | HS Code | 2933199090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| Provider | Language |
|
ALFA
| English |
| | 1-ETHYL-3-METHYL-1H-PYRAZOLE-5-CARBOXYLIC ACID Usage And Synthesis |
| Uses | 1-Ethyl-3-methyl-1H-pyrazole-5-carboxylic Acid is a reagent used in the synthesis of new class of 2-phenylhydrazinylidene derivatives as antivirulence agents that inhibits staphylococcus aureus biofilm formation. |
| | 1-ETHYL-3-METHYL-1H-PYRAZOLE-5-CARBOXYLIC ACID Preparation Products And Raw materials |
|