|
|
| | Bis(2-cyanoethyl)-N,N-diisopropyl phosphoramidite Basic information |
| Product Name: | Bis(2-cyanoethyl)-N,N-diisopropyl phosphoramidite | | Synonyms: | Bis(2-cyanoethyl) N,N-bis(isopropyl)phosphoramidite 96%;Bis(2-cyanoethoxy)(diisopropylamino)phosphine, Bis(2-cyanoethoxy)-N,N-diisopropylaminophosphine;REF DUPL: Bis(2-cyanoethyl)-N,N-diisopropylphosphoramidite;PhosphoraMidous acid,N,N-bis(1-Methylethyl)-, bis(2-cyanoethyl) ester;Bis(2-cyanoethyl) di(prop-2-yl)phosphoramidoite, Bis(2-cyanoethyl) N,N-diisopropylphosphoramidite;Bis(2-cyanoethyl) N,N-bis(isopropyl)phosphoramidite;Bis(2-cyanoethyl)-N,N-diisopropylphosphoramidite 95%;DIISOPROPYLAMINO-DI-(2-CYANOETHOXY)-PHOSPHINE | | CAS: | 102690-88-0 | | MF: | C12H22N3O2P | | MW: | 271.3 | | EINECS: | 802-449-5 | | Product Categories: | Phospholipids - 13C & 2H;Phosphorylating and Phosphitylating Agents;SiChem;Other | | Mol File: | 102690-88-0.mol |  |
| | Bis(2-cyanoethyl)-N,N-diisopropyl phosphoramidite Chemical Properties |
| Boiling point | 335.3±27.0 °C(Predicted) | | density | 1.039 g/mL at 25 °C | | refractive index | n20/D1.465 | | Fp | 73℃ | | storage temp. | -20°C | | solubility | Chloroform (Sparingly), DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | liquid | | pka | 3.11±0.70(Predicted) | | color | Colourless | | Stability: | Moisture Sensitive | | InChI | InChI=1S/C12H22N3O2P/c1-11(2)15(12(3)4)18(16-9-5-7-13)17-10-6-8-14/h11-12H,5-6,9-10H2,1-4H3 | | InChIKey | LDHWBEHZLFDXCU-UHFFFAOYSA-N | | SMILES | P(N(C(C)C)C(C)C)(OCCC#N)OCCC#N |
| Hazard Codes | Xi,T | | Risk Statements | 23-24-25-36-38 | | Safety Statements | 26-36-37-39-45 | | RIDADR | UN 2810 6.1 / PGIII | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 6.1 | | HS Code | 2931499090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 |
| | Bis(2-cyanoethyl)-N,N-diisopropyl phosphoramidite Usage And Synthesis |
| Chemical Properties | Light Yellow Oil | | Uses | Bis(2-cyanoethyl)-N,N-diisopropyl Phosphoramidite is a useful phosphorylating reagent. |
| | Bis(2-cyanoethyl)-N,N-diisopropyl phosphoramidite Preparation Products And Raw materials |
|