| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | MDL-12,330a hydrochloride Basic information |
| Product Name: | MDL-12,330a hydrochloride | | Synonyms: | MDL-12,330A, Hydrochloride - CAS 40297-09-4 - Calbiochem;CIS-N-(2-PHENYLCYCLOPENTYL)AZACYCLOTRIDEC-1-EN-2-AMINE HCL;CIS-N-(2-PHENYLCYCLOPENTYL)AZACYCLOTRIDEC-1-EN-2-AMINE HYDROCHLORIDE;CIS-N-(2-PHENYLCYCLOPENTYL)-AZACYCLOTRIDEC-1-EN-2-AMINE MONOHYDROCHLORIDE;MDL-12330A;MDL-12,330A HCL;MDL 12230A HYDROCHLORIDE;(±)-N-[(1R*,2R*)-2-Phenylcyclopentyl]-azacyclotridec-1-en-2-aminehydrochloride | | CAS: | 40297-09-4 | | MF: | C23H36N2.ClH | | MW: | 377.01 | | EINECS: | | | Product Categories: | | | Mol File: | 40297-09-4.mol |  |
| | MDL-12,330a hydrochloride Chemical Properties |
| storage temp. | 2-8°C | | solubility | hot 0.1 N HCl: 0.50 mg/mL | | form | solid | | color | white | | InChI | 1S/C23H36N2.ClH/c1-2-4-6-11-18-23(24-19-12-7-5-3-1)25-22-17-13-16-21(22)20-14-9-8-10-15-20;/h8-10,14-15,21-22H,1-7,11-13,16-19H2,(H,24,25);1H/t21-,22-;/m0./s1 | | InChIKey | CKOPQUCSDBVAQG-VROPFNGYSA-N | | SMILES | Cl[H].C1CCCCCN=C(CCCCC1)N[C@H]2CCC[C@H]2c3ccccc3 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | MDL-12,330a hydrochloride Usage And Synthesis |
| Uses | MDL-12,330A hydrochloride has been used as an inhibitor of adenylyl cyclase to block cyclic AMP signaling in mesenchymal stem/stromal cells (MSC). It has also been used as an adenylyl cyclase blocker to test its effect on the locomotor activity based on tail suspension test (TST) in mice. | | Biochem/physiol Actions | MDL-12,330A is a cycloalkyl lactamimide that acts as a voltage-gated potassium channel blocker (KV) leading to extension of action potential duration (APD) and favoring insulin secretion. It also blocks calcium (Ca2+)entry. |
| | MDL-12,330a hydrochloride Preparation Products And Raw materials |
|