| Company Name: |
3B Pharmachem (Wuhan) International Co.,Ltd.
|
| Tel: |
821-50328103-801 18930552037 |
| Email: |
3bsc@sina.com |
| Products Intro: |
Product Name:MDL 12330A hydrochloride;(±)-N-[(1R*,2R*)-2-Phenylcyclopentyl]-azacyclotridec-1-en-2-aMinehydrochloride
CAS:40297-09-4
Purity:99% HPLC Package:1Mg ; 5Mg;10Mg ;100Mg;250Mg ;500Mg ;1g;2.5g ;5g ;10g
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:MDL-12,330A hydrochloride
CAS:40297-09-4
Purity:>=98% (HPLC), powder Package:25MG Remarks:M182-25MG
|
|
| | MDL-12,330A HYDROCHLORIDE Basic information |
| Product Name: | MDL-12,330A HYDROCHLORIDE | | Synonyms: | MDL-12,330A, Hydrochloride - CAS 40297-09-4 - Calbiochem;CIS-N-(2-PHENYLCYCLOPENTYL)AZACYCLOTRIDEC-1-EN-2-AMINE HCL;CIS-N-(2-PHENYLCYCLOPENTYL)AZACYCLOTRIDEC-1-EN-2-AMINE HYDROCHLORIDE;CIS-N-(2-PHENYLCYCLOPENTYL)-AZACYCLOTRIDEC-1-EN-2-AMINE MONOHYDROCHLORIDE;MDL-12330A;MDL-12,330A HCL;MDL-12,330A HYDROCHLORIDE;MDL 12230A HYDROCHLORIDE | | CAS: | 40297-09-4 | | MF: | C23H37ClN2 | | MW: | 377.01 | | EINECS: | | | Product Categories: | | | Mol File: | 40297-09-4.mol |  |
| | MDL-12,330A HYDROCHLORIDE Chemical Properties |
| storage temp. | 2-8°C | | solubility | hot 0.1 N HCl: 0.50 mg/mL | | form | solid | | color | white | | InChI | 1S/C23H36N2.ClH/c1-2-4-6-11-18-23(24-19-12-7-5-3-1)25-22-17-13-16-21(22)20-14-9-8-10-15-20;/h8-10,14-15,21-22H,1-7,11-13,16-19H2,(H,24,25);1H/t21-,22-;/m0./s1 | | InChIKey | CKOPQUCSDBVAQG-VROPFNGYSA-N | | SMILES | Cl[H].C1CCCCCN=C(CCCCC1)N[C@H]2CCC[C@H]2c3ccccc3 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | MDL-12,330A HYDROCHLORIDE Usage And Synthesis |
| Uses | MDL-12,330A hydrochloride has been used as an inhibitor of adenylyl cyclase to block cyclic AMP signaling in mesenchymal stem/stromal cells (MSC). It has also been used as an adenylyl cyclase blocker to test its effect on the locomotor activity based on tail suspension test (TST) in mice. | | Biochem/physiol Actions | MDL-12,330A is a cycloalkyl lactamimide that acts as a voltage-gated potassium channel blocker (KV) leading to extension of action potential duration (APD) and favoring insulin secretion. It also blocks calcium (Ca2+)entry. |
| | MDL-12,330A HYDROCHLORIDE Preparation Products And Raw materials |
|