|
|
| | 5-Maleimidofluorescein diacetate Basic information |
| Product Name: | 5-Maleimidofluorescein diacetate | | Synonyms: | Fluorescein diacetate 5-maleimide for fluorescence;5-(N-Maleimido)fluorescein diacetate;5-Maleimido-fluorescein diacetate, Fluorescein-5-maleimide diacetate;1-[3',6'-Bis(acetyloxy)-3-oxospiro[isobenzofuran-1(3H),9'-[9H]xanthen]-5-yl]-1H-pyrrole-2,5-dione;1H-Pyrrole-2,5-dione, 1-[3',6'-bis(acetyloxy)-3-oxospiro[isobenzofuran-1(3H),9'-[9H]xanthen]-5-yl]-;Fluorescein diacetate 5-maleimide suitable for fluorescence;Fluorescein diacetate 5-maleimide?Chemical Structure;Fluorescein diacetate 5-maleimide, Fluorescent marker used in microscopy studies | | CAS: | 150322-01-3 | | MF: | C28H17NO9 | | MW: | 511.44 | | EINECS: | | | Product Categories: | | | Mol File: | 150322-01-3.mol |  |
| | 5-Maleimidofluorescein diacetate Chemical Properties |
| Melting point | 228-229°C | | storage temp. | −20°C | | solubility | DMF: soluble | | form | solid | | InChI | 1S/C28H17NO9/c1-14(30)35-17-4-7-21-23(12-17)37-24-13-18(36-15(2)31)5-8-22(24)28(21)20-6-3-16(11-19(20)27(34)38-28)29-25(32)9-10-26(29)33/h3-13H,1-2H3 | | InChIKey | WZBJWHQRQDEKOF-UHFFFAOYSA-N | | SMILES | CC(=O)Oc1ccc2c(Oc3cc(OC(C)=O)ccc3C24OC(=O)c5cc(ccc45)N6C(=O)C=CC6=O)c1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 8-10-21 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 5-Maleimidofluorescein diacetate Usage And Synthesis |
| Uses | Formation of conjugates with immunoreactant for photoluminometric immunoassay by fluorescent energy transfer. |
| | 5-Maleimidofluorescein diacetate Preparation Products And Raw materials |
|