|
|
| | 3-(Dimethylamino)benzoic acid Basic information |
| | 3-(Dimethylamino)benzoic acid Chemical Properties |
| Melting point | 148-150 °C(lit.) | | Boiling point | 293.03°C (rough estimate) | | density | 1.1603 (rough estimate) | | refractive index | 1.5200 (estimate) | | storage temp. | Store below +30°C. | | solubility | methanol: 50mg/mL, clear to very slightly hazy, yellow to brown | | pka | 3.36±0.10(Predicted) | | form | Crystalline Powder | | color | Light yellow to yellow-beige | | Water Solubility | Soluble in methanol (50 mg/ml). Insoluble in water. | | BRN | 2208586 | | InChI | InChI=1S/C9H11NO2/c1-10(2)8-5-3-4-7(6-8)9(11)12/h3-6H,1-2H3,(H,11,12) | | InChIKey | NEGFNJRAUMCZMY-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC(N(C)C)=C1 | | CAS DataBase Reference | 99-64-9(CAS DataBase Reference) | | EPA Substance Registry System | Benzoic acid, 3-(dimethylamino)- (99-64-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29224995 | | Storage Class | 11 - Combustible Solids |
| | 3-(Dimethylamino)benzoic acid Usage And Synthesis |
| Chemical Properties | Light yellow to yellow-beige crystalline powder | | Uses | 3-Dimethylaminobenzoic acid is used as a benzoic acid derivative. | | Uses | 3-(Dimethylamino)benzoic acid has been used to analyse glucose content from the extraction of starch and soluble sugars. | | Biochem/physiol Actions |
3-(Dimethylamino)benzoic acid can be used to quantity the activity of peroxidase and manganese peroxidase.
| | Synthesis | In a 250 mL three-neck flask, 95 mL of methanol and 3 mL of tetrahydrofuran were added, followed by 16.7 g of m-nitrobenzoic acid and 0.2 g of 5% palladium carbon catalyst. A constant pressure dropping funnel was installed and 15.2 mL of 37% formaldehyde aqueous solution was added to it. The air in the reaction system was replaced with hydrogen via an air pump. The reaction system was warmed up to 64 °C and the reaction was stirred at this temperature until hydrogen uptake stopped. Subsequently, the hydrogenation reaction was continued by slowly adding the formaldehyde solution through a dropping funnel until the hydrogen uptake stopped again. After stopping stirring, the reaction mixture was filtered to recover the catalyst. The filtrate was concentrated to precipitate the product m-dimethylaminobenzoic acid. The precipitate was collected by filtration, washed with a small amount of water and dried at 100 °C to give 15.3 g of m-dimethylaminobenzoic acid in 93% yield. The recovered catalyst was washed with reaction solvent and could be reused in subsequent reactions. | | References | [1] Patent: CN107056633, 2017, A. Location in patent: Paragraph 0013; 0014; 0015; 0016
[2] Journal of the Chemical Society, 1950, p. 1342,1345 |
| | 3-(Dimethylamino)benzoic acid Preparation Products And Raw materials |
|