|
|
| | Iron(III) p-toluenesulfonate hexahydrate Basic information |
| | Iron(III) p-toluenesulfonate hexahydrate Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | InChI | InChI=1S/C7H8O3S.Fe.H2O/c1-6-2-4-7(5-3-6)11(8,9)10;;/h2-5H,1H3,(H,8,9,10);;1H2 | | InChIKey | HYNQBAXFHIYZQQ-UHFFFAOYSA-N | | SMILES | S(C1C=CC(C)=CC=1)(O)(=O)=O.[Fe].O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-41 | | Safety Statements | 26-36-39-24 | | WGK Germany | 1 | | HS Code | 29041000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 |
| | Iron(III) p-toluenesulfonate hexahydrate Usage And Synthesis |
| Uses | Iron(III) p-toluenesulfonate hexahydrate is an oxidizing agent used in the synthesis of manganese dioxide nanoparticles as modifiers for conducting polymers. | | Uses | Iron(III) p-toluenesulfonate hexahydrate (Fe(CH3C6H4SO3)3·6H2O) can be used:
- As an oxidant in the synthesis of poly(3,4-ethylenedioxythiophene) (PEDOT) nanofilms by vapor phase polymerization.
- In the synthesis of iron(III) complex of pyridoxal-4-methylthiosemicarbazone.
- As a precursor material for the synthesis of Fe, N, and S functionalized carbon electrocatalyst for the oxygen reduction reaction.
- As an oxidant in the synthesis of poly(thiophene phenylenes) (PThP).
| | Application | The influence of spin-coated iron(III) p-toluenesulfonate hexahydrate (Fe(PTS)3) oxidant solution on the polymerization and resulting PEDOT structures was investigated by Jaegab Lee team[1]. Spin-coated low-density (1.35 g/cm3) Fe(PTS)3 oxidant solution, consisting of highly anisotropic paracystalline structures, provided open frameworks for the growth of conducting polymers, leading to a-axis oriented paracrystalline PEDOT films. | | reaction suitability | core: iron reagent type: catalyst | | References | [1] Ali, M. A., Kim, H., Lee, C., Nam, H., Lee, J. (2011). Effects of iron(III) p-toluenesulfonate hexahydrate oxidant on the growth of conductive poly(3,4-ethylenedioxythiophene) (PEDOT) nanofilms by vapor phase polymerization. Synthetic Metals, 161 13, Pages 1347-1352. https://doi.org/10.1016/j.synthmet.2011.04.036
|
| | Iron(III) p-toluenesulfonate hexahydrate Preparation Products And Raw materials |
|