| Company Name: |
Wuhan Chemwish Technology Co., Ltd
|
| Tel: |
86-027-67849912 |
| Email: |
sales@chemwish.com |
| Products Intro: |
Product Name:E-2-(3-Chlorophenyl)vinylboronic acid,pinacol ester CAS:871125-84-7 Purity:95% Package:1g;5g;25g;50g;100g
|
|
| | TRANS-2-(3-CHLOROPHENYL)VINYLBORONIC AC& Basic information |
| Product Name: | TRANS-2-(3-CHLOROPHENYL)VINYLBORONIC AC& | | Synonyms: | (E)-2-(3-chlorostyryl)-4,4,5,5-tetramethyl-1,3-dioxa-2-borolane;trans-2-(3-Chlorophenyl)vinylboronic acid pinacol ester 97%;TRANS-2-(3-CHLOROPHENYL)VINYLBORONIC;TRANS-2-(3-CHLOROPHENYL)VINYLBORONIC AC&;2-[(E)-2-(3-chlorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;E-2-(3-Chlorophenyl)vinylboronic acid,pinacol ester;3-chloro-trans-beta-styrylboronic acid pinacol ester;(E-2-(3-Chlorophenyl)vinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | | CAS: | 871125-84-7 | | MF: | C14H18BClO2 | | MW: | 264.56 | | EINECS: | | | Product Categories: | | | Mol File: | 871125-84-7.mol |  |
| | TRANS-2-(3-CHLOROPHENYL)VINYLBORONIC AC& Chemical Properties |
| Boiling point | 138-140 °C0.9-1.0 mm Hg | | density | 1.049 g/mL at 25 °C | | refractive index | n20/D 1.536 | | Fp | >230 °F | | storage temp. | 2-8°C | | Appearance | Light yellow to yellow Liquid | | InChI | 1S/C14H18BClO2/c1-13(2)14(3,4)18-15(17-13)9-8-11-6-5-7-12(16)10-11/h5-10H,1-4H3/b9-8+ | | InChIKey | NZBKTAJNGYXYSQ-CMDGGOBGSA-N | | SMILES | CC1(C)OB(OC1(C)C)\C=C\c2cccc(Cl)c2 |
| WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 12 - Non Combustible Liquids |
| | TRANS-2-(3-CHLOROPHENYL)VINYLBORONIC AC& Usage And Synthesis |
| Uses | E-2-(3-Chlorophenyl)vinylboronic acid, pinacol ester | | Uses | trans-2-(3-Chlorophenyl)vinylboronic acid pinacol ester can be used as a reactant:
- To prepare aryl derivatives by CC bond formation via palladium-catalyzed SuzukiMiyaura reaction.
- In the diastereoselective synthesis of alkenes via K3PO4-promoted transition metal-free nucleophilic substitution of unactivated alkyl triflates.
- To synthesize (3-chlorophenyl)cyclopropyl boronic acid pinacol ester by reacting with diazomethane.
|
| | TRANS-2-(3-CHLOROPHENYL)VINYLBORONIC AC& Preparation Products And Raw materials |
|